Få mere at vide
Emodin, Thermo Scientific™
A protein tyrosine kinase inhibitor
Brand: Thermo Scientific Alfa Aesar J61600.MD
| Mængde | 250mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| C15H10O5 | |
| MFCD00001207 | |
| emodin, schuttgelb, emodol, frangula emodin, rheum emodin, frangulic acid, 3-methyl-1,6,8-trihydroxyanthraquinone, archin, persian berry lake, 1,3,8-trihydroxy-6-methyl-9,10-anthraquinone | |
| CHEBI:42223 | |
| CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O |
Tekniske data
| Emodin | |
| C15H10O5 | |
| 250mg | |
| 14,3561 | |
| RHMXXJGYXNZAPX-UHFFFAOYSA-N | |
| 1,3,8-trihydroxy-6-methylanthracene-9,10-dione | |
| 3220 | |
| 270.24 |
| 518-82-1 | |
| MFCD00001207 | |
| 1888141 | |
| emodin, schuttgelb, emodol, frangula emodin, rheum emodin, frangulic acid, 3-methyl-1,6,8-trihydroxyanthraquinone, archin, persian berry lake, 1,3,8-trihydroxy-6-methyl-9,10-anthraquinone | |
| CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)O)O | |
| 270.24 | |
| CHEBI:42223 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.