missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Difloxacin hydrochloride, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J63754.14
| Mængde | 25g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- A quinolone antibacterial compound
- Structurally related to norfloxacin
Kemiske identifikatorer
| 91296-86-5 | |
| 435.856 | |
| JFMGBGLSDVIOHL-UHFFFAOYSA-N | |
| 56205 | |
| CN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl |
| C21H20ClF2N3O3 | |
| MFCD03840489 | |
| difloxacin hydrochloride, difloxacin hcl, unii-xj0260hj0o, abbott-56619, 6-fluoro-1-4-fluorophenyl-7-4-methylpiperazin-1-yl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride, difloxacin hydrochloride usan, dsstox_cid_26599, dsstox_rid_81754, dsstox_gsid_46599 | |
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
Tekniske data
| Difloxacin hydrochloride | |
| C21H20ClF2N3O3 | |
| 25g | |
| 14,3141 | |
| Soluble in aqueous buffer | |
| CN1CCN(CC1)C2=C(C=C3C(=C2)N(C=C(C3=O)C(=O)O)C4=CC=C(C=C4)F)F.Cl | |
| 435.856 | |
| 435.85 |
| 91296-86-5 | |
| MFCD03840489 | |
| 6464798 | |
| difloxacin hydrochloride, difloxacin hcl, unii-xj0260hj0o, abbott-56619, 6-fluoro-1-4-fluorophenyl-7-4-methylpiperazin-1-yl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid hydrochloride, difloxacin hydrochloride usan, dsstox_cid_26599, dsstox_rid_81754, dsstox_gsid_46599 | |
| JFMGBGLSDVIOHL-UHFFFAOYSA-N | |
| 6-fluoro-1-(4-fluorophenyl)-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride | |
| 56205 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?