missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Cefmetazole sodium, 921μg/mg, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66348.03
| Mængde | 1g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- Cefmetazole is used to study the effect of expression, binding, and inhibition of penicillin-binding proteins (with the exception of PBP2) on bacterial cell wall mucopeptide synthesis
- It is also used to study protein mediated antibiotic tr
Kemiske identifikatorer
| 56796-39-5 | |
| 493.507 | |
| BITQGIOJQWZUPL-PBCQUBLHSA-M | |
| CHEBI:3490 | |
| CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC#N)OC)SC2)C(=O)[O-].[Na+] |
| C15H16N7NaO5S3 | |
| MFCD00214260 | |
| 23666711 | |
| sodium;(6R,7S)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
Tekniske data
| Cefmetazole sodium | |
| 56796-39-5 | |
| 1g | |
| C15H16N7NaO5S3 | |
| Soluble in water | |
| CN1C(=NN=N1)SCC2=C(N3C(C(C3=O)(NC(=O)CSCC#N)OC)SC2)C(=O)[O-].[Na+] | |
| 493.507 | |
| CHEBI:3490 |
| 921μg/mg | |
| White | |
| Hygroscopic | |
| MFCD00214260 | |
| BITQGIOJQWZUPL-PBCQUBLHSA-M | |
| sodium;(6R,7S)-7-[[2-(cyanomethylsulfanyl)acetyl]amino]-7-methoxy-3-[(1-methyltetrazol-5-yl)sulfanylmethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate | |
| 23666711 | |
| 493.52 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?