Få mere at vide
Bupivacaine hydrochloride monohydrate, 98+%, Thermo Scientific™
Inhibits TREK-1 channels and depolarizes the cell membrane
Brand: Thermo Scientific Alfa Aesar J62835.14
| Mængde | 25g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsIt is employed as Na+ channel blocker, local anesthetic and cAMP production inhibitor. It acts as a surfactant molecule possessing both hydrophilic and lipophilic properties, adrenergic antagonist, EC 3.1.1.8 (cholinesterase) inhibitor and EC 3.6.3.8 (Ca(2+)-transporting ATPase) inhibitor.
Solubility
Soluble in water to 50 mM, in DMSO to 100 mM and in ethanol to 100 mM.
Notes
Store away from oxidizing agents. Keep the container tightly closed and place it in a cool, dry and well ventilated condition.
Kemiske identifikatorer
| 73360-54-0 | |
| 342.908 | |
| HUCIWBPMHXGLFM-UHFFFAOYSA-N | |
| 5282419 | |
| CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.O.Cl |
| C18H31ClN2O2 | |
| MFCD00078956 | |
| bupivacaine hydrochloride monohydrate, lac-43, marcaine tn, +/--1-butyl-2',6'-pipecoloxylidide monohydrochloride, monohydrate, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrate hydrochloride, bupivacaine hydrate hydrochloride, bupivacaine hcl h2-o, 2-piperidinecarboxamide, 1-butyl-n-2,6-dimethylphenyl-, monohydrochloride, monohydrate, bupivacaine hydrochloride ep, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrochloride hydrate | |
| 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrate;hydrochloride |
Tekniske data
| Bupivacaine hydrochloride monohydrate | |
| C18H31ClN2O2 | |
| 25g | |
| 14,1495 | |
| Soluble in water to 50 mM,in DMSO to 100 mM and in ethanol to 100 mM. | |
| CCCCN1CCCCC1C(=O)NC2=C(C=CC=C2C)C.O.Cl | |
| 342.908 | |
| 342.9 |
| 73360-54-0 | |
| MFCD00078956 | |
| UN2811 | |
| bupivacaine hydrochloride monohydrate, lac-43, marcaine tn, +/--1-butyl-2',6'-pipecoloxylidide monohydrochloride, monohydrate, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrate hydrochloride, bupivacaine hydrate hydrochloride, bupivacaine hcl h2-o, 2-piperidinecarboxamide, 1-butyl-n-2,6-dimethylphenyl-, monohydrochloride, monohydrate, bupivacaine hydrochloride ep, 1-butyl-n-2,6-dimethylphenyl piperidine-2-carboxamide hydrochloride hydrate | |
| HUCIWBPMHXGLFM-UHFFFAOYSA-N | |
| 1-butyl-N-(2,6-dimethylphenyl)piperidine-2-carboxamide;hydrate;hydrochloride | |
| 5282419 | |
| ≥98% |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.