Få mere at vide
Amlodipine, 97+%, Thermo Scientific™
A calcium channel antagonist with potent antioxidant activity
Brand: Thermo Scientific Alfa Aesar J62242.09
| Mængde | 10g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in dimethyl sulfoxide, ethanol, water, dimethyl formamide, acetone, chloroform, ethyl acetate and methanol.
Notes
Incompatible with oxidizing agents.
Kemiske identifikatorer
| 88150-42-9 | |
| 408.88 | |
| HTIQEAQVCYTUBX-UHFFFAOYNA-N | |
| 2162 | |
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| C20H25ClN2O5 | |
| MFCD00864687 | |
| amlodipine, norvasc, amlodis, amlodipino, amlodipinum, amlocard, coroval, lipinox, amlor, amlodipinum latin | |
| CHEBI:2668 | |
| CCOC(=O)C1=C(COCCN)NC(C)=C(C1C1=CC=CC=C1Cl)C(=O)OC |
Tekniske data
| Amlodipine | |
| C20H25ClN2O5 | |
| 10g | |
| 14,491 | |
| Soluble in dimethyl sulfoxide,ethanol,water,dimethyl formamide,acetone,chloroform,ethyl acetate and methanol. | |
| CCOC(=O)C1=C(COCCN)NC(C)=C(C1C1=CC=CC=C1Cl)C(=O)OC | |
| 408.88 | |
| CHEBI:2668 | |
| ≥97% |
| 88150-42-9 | |
| MFCD00864687 | |
| UN2811 | |
| amlodipine, norvasc, amlodis, amlodipino, amlodipinum, amlocard, coroval, lipinox, amlor, amlodipinum latin | |
| HTIQEAQVCYTUBX-UHFFFAOYNA-N | |
| 3-ethyl 5-methyl 2-[(2-aminoethoxy)methyl]-4-(2-chlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate | |
| 2162 | |
| 408.88 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.