missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
3-Tropanylindole-3-carboxylate hydrochloride, Thermo Scientific™
A selective 5-HT3 serotonin receptor antagonist
Brand: Thermo Scientific Alfa Aesar J62807.MC
| Mængde | 100mg |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 105826-92-4 | |
| 320.817 | |
| XIEGSJAEZIGKSA-ICHLHHFLSA-N | |
| 71300439 | |
| CN1C2CCC1CC(C2)OC(=O)C3=CNC4=CC=CC=C43.Cl |
| C17H21ClN2O2 | |
| MFCD00210221 | |
| sdz-ics 930 | |
| [(5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1H-indole-3-carboxylate;hydrochloride |
Tekniske data
| 3-Tropanylindole-3-carboxylate hydrochloride | |
| C17H21ClN2O2 | |
| 100mg | |
| 14,9783 | |
| Soluble in water | |
| CN1C2CCC1CC(C2)OC(=O)C3=CNC4=CC=CC=C43.Cl | |
| 320.817 | |
| 320.82 |
| 105826-92-4 | |
| MFCD00210221 | |
| UN2811 | |
| sdz-ics 930 | |
| XIEGSJAEZIGKSA-ICHLHHFLSA-N | |
| [(5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 1H-indole-3-carboxylate;hydrochloride | |
| 71300439 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?