Laboratorieoverfladeaktive stoffer og befugtningsmidler
Filtrerede søgeresultater
Triton™ X-100 (elektroforese), Fisher BioReagents™
CAS: 9002-93-1 Molekylær formel: C16H26O2 Molekylvægt (g/mol): 250.38 MDL nummer: MFCD00132505 InChI nøgle: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyethylene Glycol p-tert-Octylphenyl Ether PubChem CID: 5590 SMIL: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| MDL nummer | MFCD00132505 |
|---|---|
| PubChem CID | 5590 |
| Molekylvægt (g/mol) | 250.38 |
| CAS | 9002-93-1 |
| Synonym | Polyethylene Glycol p-tert-Octylphenyl Ether |
| SMIL | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| InChI nøgle | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molekylær formel | C16H26O2 |
Dodecylsulfat, Natriumsalt 85%, Thermo Scientific Chemicals
CAS: 151-21-3 Molekylær formel: C12H25NaO4S Molekylvægt (g/mol): 288.38 MDL nummer: MFCD00036175 InChI nøgle: DBMJMQXJHONAFJ-UHFFFAOYSA-M Synonym: Dodecyl Sodium Sulfate,SDS,Sodium lauryl sulfate PubChem CID: 3423265 ChEBI: CHEBI:8984 IUPAC navn: sodium dodecyl sulfate SMIL: [Na+].CCCCCCCCCCCCOS([O-])(=O)=O
| MDL nummer | MFCD00036175 |
|---|---|
| PubChem CID | 3423265 |
| Molekylvægt (g/mol) | 288.38 |
| CAS | 151-21-3 |
| ChEBI | CHEBI:8984 |
| Synonym | Dodecyl Sodium Sulfate,SDS,Sodium lauryl sulfate |
| SMIL | [Na+].CCCCCCCCCCCCOS([O-])(=O)=O |
| IUPAC navn | sodium dodecyl sulfate |
| InChI nøgle | DBMJMQXJHONAFJ-UHFFFAOYSA-M |
| Molekylær formel | C12H25NaO4S |
Thermo Scientific Chemicals Triton™ X-114
CAS: 9002-93-1 Molekylær formel: C16H26O2 Molekylvægt (g/mol): 250.38 MDL nummer: MFCD00132505 InChI nøgle: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyoxyethylene(8) octylphenyl ether PubChem CID: 5590 IUPAC navn: 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol SMIL: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| MDL nummer | MFCD00132505 |
|---|---|
| PubChem CID | 5590 |
| Molekylvægt (g/mol) | 250.38 |
| CAS | 9002-93-1 |
| Synonym | Polyoxyethylene(8) octylphenyl ether |
| SMIL | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| IUPAC navn | 2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]ethanol |
| InChI nøgle | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molekylær formel | C16H26O2 |
Thermo Scientific Chemicals Triton™ X-405, 70% solution in water
CAS: 9002-93-1 | C16H26O2 | 250.38 g/mol
| MDL nummer | MFCD00132505 |
|---|---|
| Kemisk navn eller materiale | Triton™ X-405 |
| Specifik vægtfylde | 1.08 |
| Sundhedsfare 3 | GHS P Statement: Avoid release to the environment. WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification. |
| Sundhedsfare 2 | GHS H Statement: Harmful to aquatic life with long lasting effects. |
| Formel vægt | 1968.47 |
| Opløselighedsinformation | Solubility in water: soluble. |
| Emballage | Glass bottle |
| Procent renhed | ≥65% |
| Merck Index | 15, 6850 |
| Fysisk form | Liquid |
| Farve | Yellow |
| Brydningsindeks | 1.4360 to 1.4380 |
| Navn note | 70% Solution in Water |
| PubChem CID | 5590 |
| Molekylvægt (g/mol) | 250.38 |
| Tæthed | 1.0800g/mL |
| CAS | 7732-18-5 |
| Smeltepunkt | -4.0°C |
| SMIL | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| Kogepunkt | 120.0°C |
| Flammepunkt | >109°C |
| InChI nøgle | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molekylær formel | C16H26O2 |
Triton™ X-100, Thermo Scientific™
CAS: 9002-93-1 Molekylær formel: C16H26O2 Molekylvægt (g/mol): 250.38 MDL nummer: MFCD00132505 InChI nøgle: JYCQQPHGFMYQCF-UHFFFAOYSA-N Synonym: Polyoxyethylene(10) octylphenyl ether PubChem CID: 5590 SMIL: CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1
| MDL nummer | MFCD00132505 |
|---|---|
| PubChem CID | 5590 |
| Molekylvægt (g/mol) | 250.38 |
| CAS | 9002-93-1 |
| Synonym | Polyoxyethylene(10) octylphenyl ether |
| SMIL | CC(C)(C)CC(C)(C)C1=CC=C(OCCO)C=C1 |
| InChI nøgle | JYCQQPHGFMYQCF-UHFFFAOYSA-N |
| Molekylær formel | C16H26O2 |