Pentacarboxylsyrer og derivater
Organiske forbindelser, der indeholder fem carboxylgrupper; carboxylgrupper består af en carbonylgruppe bundet til en hydroxygruppe. Omfatter forbindelser, der er afledt af pentakarboxylsyrer.
Filtrerede søgeresultater
Produkter fra nogle af vores leverandører vises ikke i filtrerede søgeresultater.
ryd alle filtre
for at se disse produkter.
Søgning efter nøgleord:
Ryd søgning
1
–
2
af
2
Resultater
Thermo Scientific Chemicals o-Cresolphtalein complexone, indikatorkvalitet
CAS: 2411-89-4 Molekylær formel: C32H32N2O12 Molekylvægt (g/mol): 636.61 MDL nummer: MFCD00005911 InChI nøgle: IYZPEGVSBUNMBE-UHFFFAOYSA-N Synonym: o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f PubChem CID: 75485 IUPAC navn: 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]eddikesyre SMIL: CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1
| MDL nummer | MFCD00005911 |
|---|---|
| PubChem CID | 75485 |
| Molekylvægt (g/mol) | 636.61 |
| CAS | 2411-89-4 |
| Synonym | o-cresolphthalein complexone,phthalein purple,cresolphthalexon,o-cresolphthalexon,phthalein complexon,o-cresolphthalein complexon,cresolphthalein complexon,metal phthalein,cresolphthalein complexone,unii-a4p6737i7f |
| SMIL | CC1=CC(=CC(CN(CC(O)=O)CC(O)=O)=C1O)C1(OC(=O)C2=CC=CC=C12)C1=CC(C)=C(O)C(CN(CC(O)=O)CC(O)=O)=C1 |
| IUPAC navn | 2-[[5-[1-[3-[[bis(carboxymethyl)amino]methyl]-4-hydroxy-5-methylphenyl]-3-oxo-2-benzofuran-1-yl]-2-hydroxy-3-methylphenyl]methyl-(carboxymethyl)amino]eddikesyre |
| InChI nøgle | IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| Molekylær formel | C32H32N2O12 |
Thermo Scientific Chemicals Diethylentriaminpentaeddikesyre, pentanatriumsalt, tech., 40% vandig opløsning
CAS: 140-01-2 | C14H18N3Na5O10 | 503.26 g/mol
| MDL nummer | MFCD00051016 |
|---|---|
| Lineær formel | NaOCOCH2N(CH2CH2N(CH2COONa)2)2 |
| Sundhedsfare 3 | GHS P Statement Wash face,hands and any exposed skin thoroughly after handling. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Cont |
| Sundhedsfare 2 | GHS H Statement Causes serious eye irritation. |
| Sundhedsfare 1 | GHS-signalord: Advarsel |
| Formel vægt | 503.26 |
| Emballage | Glasflaske |
| Procent renhed | 39 to 41% |
| IUPAC navn | pentanatrium;2-[bis[2-[bis(carboxylatomethyl)amino]ethyl]amino]acetat |
| Grad | Teknisk |
| Brydningsindeks | 1.4185 to 1.4205 |
| Navn note | 40% Aqueous Solution |
| PubChem CID | 8779 |
| Molekylvægt (g/mol) | 503.26 |
| Tæthed | 1.2900g/mL |
| Smeltepunkt | -40°C |
| pH | 11.0 to 12.0 (1% aq. soln.) |
| SMIL | [Na+].[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CCN(CC([O-])=O)CC([O-])=O |
| Kogepunkt | 106°C |
| Flammepunkt | >100°C |
| InChI nøgle | LQPLDXQVILYOOL-UHFFFAOYSA-I |
| Kemisk navn eller materiale | Diethylenetriaminepentaacetic acid, pentasodium salt |
| Specifik vægtfylde | 1.29 |
| Opløselighedsinformation | Solubility in water: soluble. Other solubilities: mixible with many organic solvents |
| Fysisk form | Løsning |
| EINECS nummer | 205-391-3 |
| CAS | 7732-18-5 |
| Synonym | pentasodium dtpa,tetralon b,trilon c,versenex 80,pentasodium pentetate,hamp-ex 80,detarex py,kiresuto p,chelest p,plexene d |
| Beilstein | 04, III, 1190 |
| Molekylær formel | C14H18N3Na5O10 |