Få mere at vide
Xylazine hydrochloride, Thermo Scientific™
Agonist at the alpha-2 adrenergic receptor
Brand: Thermo Scientific Alfa Aesar J62394.06
| Mængde | 5g |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 23076-35-9 | |
| 256.79 | |
| QYEFBJRXKKSABU-UHFFFAOYSA-N | |
| 68554 | |
| [H+].[Cl-].CC1=CC=CC(C)=C1NC1=NCCCS1 |
| C12H17ClN2S | |
| MFCD00058196 | |
| xylazine hydrochloride, xylazine hcl, n-2,6-dimethylphenyl-5,6-dihydro-4h-1,3-thiazin-2-amine hydrochloride, celactal, xylazine chloride, bay 1470 hydrochloride, unii-ngc3s0882s, ccris 8685, bay va 1470 | |
| hydrogen N-(2,6-dimethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine chloride |
Tekniske data
| Xylazine hydrochloride | |
| C12H17ClN2S | |
| 5g | |
| 6448471 | |
| xylazine hydrochloride, xylazine hcl, n-2,6-dimethylphenyl-5,6-dihydro-4h-1,3-thiazin-2-amine hydrochloride, celactal, xylazine chloride, bay 1470 hydrochloride, unii-ngc3s0882s, ccris 8685, bay va 1470 | |
| QYEFBJRXKKSABU-UHFFFAOYSA-N | |
| hydrogen N-(2,6-dimethylphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine chloride | |
| 68554 |
| 23076-35-9 | |
| MFCD00058196 | |
| UN2811 | |
| 14,10080 | |
| Soluble in water | |
| [H+].[Cl-].CC1=CC=CC(C)=C1NC1=NCCCS1 | |
| 256.79 | |
| 256.79 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.