Learn More
Trolox(R), 97%, Thermo Scientific™
Brand: Thermo Scientific Acros 218940250
Additional Details : CAS Number : 53188-07-1 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 53188-07-1 | |
| 250.29 | |
| GLEVLJDDWXEYCO-UHFFFAOYNA-N | |
| 40634 | |
| 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid |
| C14H18O4 | |
| MFCD00006846 | |
| trolox, 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid, trolox c, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-2h-1-benzopyran-2-carboxylic acid, 6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid, 2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl, +/--6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid, 2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-, +-, trolox™, trolox tm | |
| CHEBI:82625 | |
| CC1=C(C)C2=C(CCC(C)(O2)C(O)=O)C(C)=C1O |
Specifications
| Trolox* | |
| 53188-07-1 | |
| 187.0°C to 194.0°C | |
| Authentic | |
| MFCD00006846 | |
| Glass bottle | |
| 25g | |
| GLEVLJDDWXEYCO-UHFFFAOYNA-N | |
| 6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromene-2-carboxylic acid | |
| 40634 | |
| 250.29 | |
| 97% |
| 97% | |
| Beige to White | |
| 97% | |
| C14H18O4 | |
| 18, V,7, 335 | |
| trolox, 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid, trolox c, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-2h-1-benzopyran-2-carboxylic acid, 6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid, 2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl, +/--6-hydroxy-2,5,7,8-tetramethylchromane-2-carboxylic acid, 2h-1-benzopyran-2-carboxylic acid, 3,4-dihydro-6-hydroxy-2,5,7,8-tetramethyl-, +-, trolox™, trolox tm | |
| Solubility in water: slightly soluble. Other solubilities: soluble in methanol, ethanol | |
| CC1=C(C)C2=C(CCC(C)(O2)C(O)=O)C(C)=C1O | |
| 250.29 | |
| CHEBI:82625 | |
| Crystalline Powder |
RUO – Research Use Only