Learn More
Tris(4-methoxyphenyl)phosphine, 95%, ACROS Organics™
Brand: Acros Organics 422240100
Additional Details : CAS Number : 855-38-9 Weight : 0.06000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 10g |
Chemical Identifiers
| 855-38-9 | |
| 352.36 | |
| UYUUAUOYLFIRJG-UHFFFAOYSA-N | |
| 70071 | |
| COC1=CC=C(C=C1)P(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC |
| C21H21O3P | |
| MFCD00014896 | |
| tris 4-methoxyphenyl phosphine, trianisylphosphine, tris p-anisyl phosphine, phosphine, tris 4-methoxyphenyl, tri-p-anisylphosphine, tris p-methoxyphenyl phosphine, tris 4-methoxyphenyl phosphane, phosphine, tris p-methoxyphenyl, tri 4-methoxyphenyl phosphine, tri p-methoxyphenyl phosphine | |
| tris(4-methoxyphenyl)phosphane |
Specifications
| Tris(4-methoxyphenyl)phosphine | |
| Glass bottle | |
| 131.0°C to 134.0°C | |
| 95% | |
| 94% min. (GC) | |
| MFCD00014896 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in methanol | |
| COC1=CC=C(C=C1)P(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC | |
| 352.36 | |
| 352.36 | |
| 95% |
| Authentic | |
| White to Yellow | |
| 10g | |
| 855-38-9 | |
| C21H21O3P | |
| tris 4-methoxyphenyl phosphine, trianisylphosphine, tris p-anisyl phosphine, phosphine, tris 4-methoxyphenyl, tri-p-anisylphosphine, tris p-methoxyphenyl phosphine, tris 4-methoxyphenyl phosphane, phosphine, tris p-methoxyphenyl, tri 4-methoxyphenyl phosphine, tri p-methoxyphenyl phosphine | |
| UYUUAUOYLFIRJG-UHFFFAOYSA-N | |
| tris(4-methoxyphenyl)phosphane | |
| 70071 | |
| Crystalline Powder |