Learn More
Alfa Aesar™ Tetrabenzyl pyrophosphate, 98%
Brand: Alfa Aesar™ L09083.06
Additional Details : CAS Number : 990-91-0 Weight : 0.00500kg Transport : UN number : 3261 Chem class : 8 Pack group : III
| Quantity | 5g |
|---|
Description
ApplicationsTetrabenzyl pyrophosphate is used in the preparation of phosphoryl derivatives of shikimic acid in the presence of LDA. It is used in the preparation of dibenzyl phosphoro fluoridate in the presence of cesium fluoride as a catalyst. It is also used as a precursor in pharmaceuticals and involved in the phosphorylation of inositol derivatives.
Solubility
Slightly soluble in water.
Notes
Moisture sensitive. Incompatible with strong oxidizing agents, strong acid and bases and reducing agents.
Chemical Identifiers
| 990-91-0 | |
| 538.473 | |
| NSBNXCZCLRBQTA-UHFFFAOYSA-N | |
| 563183 | |
| C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
| C28H28O7P2 | |
| MFCD00051941 | |
| tetrabenzyl pyrophosphate, tetrabenzyl diphosphate, pyrophosphoric acid tetrabenzyl ester, tetrabenzylpyrophosphate, diphosphoric acid, tetrakis phenylmethyl ester, dibenzyl dibenzyloxyphosphoryl oxyphosphonate, benzyl pyrophosphate, acmc-209sbp, tetra benzyl pyrophosphate, tetrabenzyl diphosphate # | |
| dibenzyl bis(phenylmethoxy)phosphoryl phosphate |
Specifications
| Tetrabenzyl pyrophosphate | |
| 58°C to 64°C | |
| 990-91-0 | |
| MFCD00051941 | |
| 2068292 | |
| Slightly soluble in water. | |
| C1=CC=C(C=C1)COP(=O)(OCC2=CC=CC=C2)OP(=O)(OCC3=CC=CC=C3)OCC4=CC=CC=C4 | |
| 538.473 | |
| 538.48 |
| Moisture sensitive | |
| 5g | |
| C28H28O7P2 | |
| UN3261 | |
| tetrabenzyl pyrophosphate, tetrabenzyl diphosphate, pyrophosphoric acid tetrabenzyl ester, tetrabenzylpyrophosphate, diphosphoric acid, tetrakis phenylmethyl ester, dibenzyl dibenzyloxyphosphoryl oxyphosphonate, benzyl pyrophosphate, acmc-209sbp, tetra benzyl pyrophosphate, tetrabenzyl diphosphate # | |
| NSBNXCZCLRBQTA-UHFFFAOYSA-N | |
| dibenzyl bis(phenylmethoxy)phosphoryl phosphate | |
| 563183 | |
| 98% |