Learn More
Sucrose, Molecular Biology Grade, Alfa Aesar™
For protein purification by sucrose density gradients
Brand: Alfa Aesar J65148.36
Additional Details : CAS Number : 57-50-1 Weight : 0.50000kg
| Quantity | 500g |
|---|
Description
ApplicationsSucrose is used to prepare density gradients for cell/organelle separation. In addition, sucrose can be used as a supplement in plant, insect, and bacterial culture media. It can also be used in various enzymatic assays. Sucrose is used in molecular biology for the preparation of density gradients.
Solubility
Soluble in water
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Chemical Identifiers
| 57-50-1 | |
| 342.297 | |
| CZMRCDWAGMRECN-UGDNZRGBSA-N | |
| 5988 | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| C12H22O11 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CHEBI:17992 | |
| C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
Specifications
| Sucrose | |
| Odorless | |
| 185°C to 187°C | |
| 57-50-1 | |
| MFCD00006626 | |
| sucrose, saccharose, cane sugar, sugar, table sugar, white sugar, d-sucrose, saccharum, rohrzucker, amerfand | |
| CZMRCDWAGMRECN-UGDNZRGBSA-N | |
| (2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 5988 | |
| 342.3 | |
| Molecular Biology |
| 1.58 | |
| White | |
| 500g | |
| C12H22O11 | |
| 90825 | |
| Soluble in water | |
| C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | |
| 342.297 | |
| CHEBI:17992 | |
| Crystalline Solid |