Learn More
Squaric Acid Dibutyl Ester, 97%, ACROS Organics™
Brand: Acros Organics 133170010
Additional Details : CAS Number : 2892-62-8 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 2892-62-8 | |
| 226.27 | |
| XBRWELTXMQSEIN-UHFFFAOYSA-N | |
| 65108 | |
| 3,4-dibutoxycyclobut-3-ene-1,2-dione |
| C12H18O4 | |
| MFCD00037150 | |
| dibutyl squarate, 3,4-dibutoxy-3-cyclobutene-1,2-dione, squaric acid dibutyl ester, sadbe, squaric acid dibutylester, 3,4-di-n-butoxy-3-cyclobutene-1,2-dione, unii-4rto57vg65, 1,2-dibutyl squarate, 3-cyclobutene-1,2-dione, 3,4-dibutoxy, acmc-209h5p | |
| CHEBI:53612 | |
| CCCCOC1=C(C(=O)C1=O)OCCCC |
Specifications
| Squaric acid dibutyl ester | |
| >110°C | |
| Glass bottle | |
| 1.05 | |
| Colorless to Yellow | |
| 2892-62-8 | |
| C12H18O4 | |
| 15, 8897 | |
| Solubility in water: insoluble. | |
| CCCCOC1=C(C(=O)C1=O)OCCCC | |
| 226.27 | |
| CHEBI:53612 | |
| Liquid |
| 1.0500g/mL | |
| Authentic | |
| 1.4930 to 1.4950 | |
| 121.0°C to 122.0°C (0.2 mmHg) | |
| 1g | |
| 96% min. (GC) | |
| MFCD00037150 | |
| dibutyl squarate, 3,4-dibutoxy-3-cyclobutene-1,2-dione, squaric acid dibutyl ester, sadbe, squaric acid dibutylester, 3,4-di-n-butoxy-3-cyclobutene-1,2-dione, unii-4rto57vg65, 1,2-dibutyl squarate, 3-cyclobutene-1,2-dione, 3,4-dibutoxy, acmc-209h5p | |
| XBRWELTXMQSEIN-UHFFFAOYSA-N | |
| 3,4-dibutoxycyclobut-3-ene-1,2-dione | |
| 65108 | |
| 226.27 | |
| 97% |
Safety and Handling
- Squaric acid dibutyl ester
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Respiratory sensitiser Category 1
- Skin corrosion/irritation Category 2
Hazard Statement
- H317-May cause an allergic skin reaction.
- H319-Causes serious eye irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.