Learn More
Spironolactone, 99%, ACROS Organics™
Brand: Acros Organics 207460050
Additional Details : CAS Number : 52-01-7 Weight : 0.05500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 52-01-7 | |
| 416.57 | |
| LXMSZDCAJNLERA-ZHYRCANASA-N | |
| 5833 | |
| S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate |
| C24H32O4S | |
| MFCD00082250 | |
| spironolactone, aldactone, spirolactone, verospiron, euteberol, spiroctan, spirolang, verospirone, aldactone a, spironocompren | |
| CHEBI:9241 | |
| CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C |
Specifications
| Spironolactone | |
| 0.5% max. (105°C, 2 hrs) | |
| −37° (20°C c=1,CHCl3) | |
| White to White-Yellow | |
| 5g | |
| 52-01-7 | |
| C24H32O4S | |
| 15, 8887 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in most common organic solvents | |
| CC(=O)SC1CC2=CC(=O)CCC2(C3C1C4CCC5(C4(CC3)C)CCC(=O)O5)C | |
| 416.57 | |
| CHEBI:9241 | |
| Powder |
| Authentic | |
| Glass bottle | |
| − 37.00 | |
| 198.0°C to 207.0°C | |
| 99% | |
| 98.5% min. (HPLC) | |
| MFCD00082250 | |
| spironolactone, aldactone, spirolactone, verospiron, euteberol, spiroctan, spirolang, verospirone, aldactone a, spironocompren | |
| LXMSZDCAJNLERA-ZHYRCANASA-N | |
| S-[(7R,8R,9S,10R,13S,14S,17R)-10,13-dimethyl-3,5'-dioxospiro[2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-17,2'-oxolane]-7-yl] ethanethioate | |
| 5833 | |
| 416.57 | |
| 99% |
Safety and Handling
- Spironolactone
Signal Word
- Danger
Hazard Category
- Acute toxicity Category 4
- Reproductive toxicity Category 1B
Hazard Statement
- H360F-May damage fertility.
- H302-Harmful if swallowed.
Precautionary Statement
- P201-Obtain special instructions before use.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P308+P313-IF exposed or concerned: Get medical advice/attention.