missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Puerarin, 98%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J66528.03
685.08 DKK valid until 2026-07-03
BEDSTE tilbudspris! Brug kampagnekoden "27965" for at få din tilbudspris.
| Mængde | 1g |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
- Thought to interfere with the synthesis of mycolic acids, an essential fatty acid component found in Mycobacterium cell walls
Kemiske identifikatorer
| 3681-99-0 | |
| 416.38 | |
| HKEAFJYKMMKDOR-VPRICQMDSA-N | |
| 53384442 | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC=C(C(=O)C2=CC=C1O)C1=CC=C(O)C=C1 |
| C21H20O9 | |
| MFCD00063399 | |
| 8-beta-d-glucopyranosyl-4',7-dihydroxyisoflavone | |
| 7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one |
Tekniske data
| Puerarin | |
| C21H20O9 | |
| 1g | |
| 8-beta-d-glucopyranosyl-4',7-dihydroxyisoflavone | |
| HKEAFJYKMMKDOR-VPRICQMDSA-N | |
| 7-hydroxy-3-(4-hydroxyphenyl)-8-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-4-one | |
| 53384442 | |
| 98% |
| 3681-99-0 | |
| MFCD00063399 | |
| 64198 | |
| Soluble in DMSO or DMF; Slightly soluble in water or ethanol | |
| OC[C@H]1O[C@H]([C@H](O)[C@@H](O)[C@@H]1O)C1=C2OC=C(C(=O)C2=CC=C1O)C1=CC=C(O)C=C1 | |
| 416.38 | |
| 416.38 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?