Få mere at vide
Prazosin hydrochloride, Thermo Scientific™
An alpha adrenoceptor antagonist
Brand: Thermo Scientific Alfa Aesar J61712.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsPrazosin hydrochloride is an inhibitor of PDE. Also offered in a free base form Prazosin
Solubility
Soluble in dimethyl sulfoxide, ethanol, water, methanol.
Notes
Keep container tightly closed. Store in cool, dry conditions in well sealed containers.
Kemiske identifikatorer
| 19237-84-4 | |
| 419.87 | |
| WFXFYZULCQKPIP-UHFFFAOYSA-N | |
| 68546 | |
| hydrogen 2-[4-(furan-2-carbonyl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine chloride |
| C19H22ClN5O4 | |
| MFCD00058177 | |
| prazosin hydrochloride, prazosin hcl, minipress, vasoflex, peripress, furazosin hydrochloride, deprazolin, hypovase, hypovasole, pratsiol | |
| CHEBI:8365 | |
| [H+].[Cl-].COC1=C(OC)C=C2C(N)=NC(=NC2=C1)N1CCN(CC1)C(=O)C1=CC=CO1 |
Tekniske data
| Prazosin hydrochloride | |
| C19H22ClN5O4 | |
| 1g | |
| 14,7717 | |
| Soluble in dimethyl sulfoxide,ethanol,water,methanol. | |
| [H+].[Cl-].COC1=C(OC)C=C2C(N)=NC(=NC2=C1)N1CCN(CC1)C(=O)C1=CC=CO1 | |
| 419.87 | |
| CHEBI:8365 |
| 19237-84-4 | |
| MFCD00058177 | |
| 4303561 | |
| prazosin hydrochloride, prazosin hcl, minipress, vasoflex, peripress, furazosin hydrochloride, deprazolin, hypovase, hypovasole, pratsiol | |
| WFXFYZULCQKPIP-UHFFFAOYSA-N | |
| hydrogen 2-[4-(furan-2-carbonyl)piperazin-1-yl]-6,7-dimethoxyquinazolin-4-amine chloride | |
| 68546 | |
| 419.86 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.