Learn More
Piperonylic acid, 99%, ACROS Organics™
Brand: Acros Organics 131371000
Additional Details : CAS Number : 94-53-1 Weight : 0.10000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 94-53-1 | |
| 166.13 | |
| VDVJGIYXDVPQLP-UHFFFAOYSA-N | |
| 7196 | |
| C1OC2=C(O1)C=C(C=C2)C(=O)O |
| C8H6O4 | |
| MFCD00005830 | |
| piperonylic acid, heliotropic acid, 3,4-methylenedioxybenzoic acid, benzo d 1,3 dioxole-5-carboxylic acid, 2h-1,3-benzodioxole-5-carboxylic acid, benzo 1,3 dioxole-5-carboxylic acid, protocatechuic acid methylene ether, 5-benzodioxolecarboxylic acid, 3,4-dioxymethylenebenzoic acid, 3,4-methylene dioxybenzoic acid | |
| 1,3-benzodioxole-5-carboxylic acid |
Specifications
| Piperonylic acid | |
| Plastic bottle | |
| 229°C to 235°C | |
| 99% | |
| 99% | |
| MFCD00005830 | |
| 15, 7590 | |
| Solubility in water: slightly soluble. Other solubilities: slightly soluble in chloroform,cold alcohol and,ether | |
| C1OC2=C(O1)C=C(C=C2)C(=O)O | |
| 166.13 | |
| 166.13 | |
| 99% |
| Authentic | |
| White to Beige | |
| 100g | |
| 94-53-1 | |
| C8H6O4 | |
| 19, 269 | |
| piperonylic acid, heliotropic acid, 3,4-methylenedioxybenzoic acid, benzo d 1,3 dioxole-5-carboxylic acid, 2h-1,3-benzodioxole-5-carboxylic acid, benzo 1,3 dioxole-5-carboxylic acid, protocatechuic acid methylene ether, 5-benzodioxolecarboxylic acid, 3,4-dioxymethylenebenzoic acid, 3,4-methylene dioxybenzoic acid | |
| VDVJGIYXDVPQLP-UHFFFAOYSA-N | |
| 1,3-benzodioxole-5-carboxylic acid | |
| 7196 | |
| Powder |
Safety and Handling
- Piperonylic acid
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
Hazard Statement
- H312-Harmful in contact with skin.
- H319-Causes serious eye irritation.
- H332-Harmful if inhaled.
- H302-Harmful if swallowed.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P330+P331-IF SWALLOWED: rinse mouth. Do NOT induce vomiting.
- P312-Call a POISON CENTER/doctor/physician/if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P304+P340-IF INHALED: Remove person to fresh air and keep comfortable for breathing.
- P337+P313-If eye irritation persists: Get medical advice/attention.