Learn More
Alfa Aesar™ Phenyl beta-D-glucopyranoside, 98%
A substrate used for the determination of →-D-glucosidase
Brand: Alfa Aesar™ J66885.06
Additional Details : CAS Number : 1464-44-4 Weight : 0.00500kg
| Quantity | 5g |
|---|
Chemical Identifiers
| 1464-44-4 | |
| 256.254 | |
| NEZJDVYDSZTRFS-RMPHRYRLSA-N | |
| 65080 | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol |
| C12H16O6 | |
| MFCD00064089 | |
| phenyl beta-d-glucopyranoside, phenylglucoside, phenyl-beta-d-glucopyranoside, phenol glucoside, phenyl beta-d-glucoside, phenyl-beta-d-glucoside, .beta.-d-glucopyranoside, phenyl, unii-4w3pgi3766, aryl beta-d-glucoside, glucopyranoside, phenyl-, beta-d | |
| CHEBI:28749 | |
| C1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O |
Specifications
| Phenyl beta-D-glucopyranoside | |
| White | |
| 5g | |
| C12H16O6 | |
| 87517 | |
| Soluble in water | |
| C1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O | |
| 256.254 | |
| CHEBI:28749 | |
| Powder |
| −73° (c=1 in Water) | |
| 173°C to 176°C | |
| 1464-44-4 | |
| MFCD00064089 | |
| phenyl beta-d-glucopyranoside, phenylglucoside, phenyl-beta-d-glucopyranoside, phenol glucoside, phenyl beta-d-glucoside, phenyl-beta-d-glucoside, .beta.-d-glucopyranoside, phenyl, unii-4w3pgi3766, aryl beta-d-glucoside, glucopyranoside, phenyl-, beta-d | |
| NEZJDVYDSZTRFS-RMPHRYRLSA-N | |
| (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-phenoxyoxane-3,4,5-triol | |
| 65080 | |
| 256.25 | |
| 98% |