Learn More
Phenanthridine, 98%, ACROS Organics™
Brand: Acros Organics 169250010
Additional Details : CAS Number : 229-87-8 Weight : 0.05100kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 1g |
Chemical Identifiers
| 229-87-8 | |
| 179.22 | |
| RDOWQLZANAYVLL-UHFFFAOYSA-N | |
| 9189 | |
| phenanthridine |
| C13H9N | |
| MFCD00004989 | |
| 6-phenanthridine, benzo c quinoline, 3,4-benzoquinoline, 9-azaphenanthrene, 3,4-benzoisoquinoline, 5-azaphenanthrene, unii-62qgs7cps6, ccris 1234, 62qgs7cps6 | |
| CHEBI:36421 | |
| C1=CC=C2C(=C1)C=NC3=CC=CC=C23 |
Specifications
| Phenanthridine | |
| 100°C | |
| Glass bottle | |
| White to Beige | |
| 1g | |
| 97.5% min. (GC) | |
| MFCD00004989 | |
| 6-phenanthridine, benzo c quinoline, 3,4-benzoquinoline, 9-azaphenanthrene, 3,4-benzoisoquinoline, 5-azaphenanthrene, unii-62qgs7cps6, ccris 1234, 62qgs7cps6 | |
| RDOWQLZANAYVLL-UHFFFAOYSA-N | |
| phenanthridine | |
| 9189 | |
| 179.22 | |
| 98% |
| 100g/mL | |
| Authentic | |
| 349.0°C (769.0 mmHg) | |
| 104.0°C to 108.0°C | |
| 229-87-8 | |
| C13H9N | |
| 20, 466 | |
| Solubility in water: insoluble. Other solubilities: soluble in toluene, dmso | |
| C1=CC=C2C(=C1)C=NC3=CC=CC=C23 | |
| 179.22 | |
| CHEBI:36421 | |
| Powder |
Safety and Handling
- Phenanthridine
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
- Serious eye damage/eye irritation Category 2
- Germ cell mutagenicity Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H315-Causes skin irritation.
- H319-Causes serious eye irritation.
- H341-Suspected of causing genetic defects.
- H335-May cause respiratory irritation.
- H302-Harmful if swallowed.
Precautionary Statement
- P260-Do not breathe dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.