Learn More
Phenanthrenequinone, 95%, ACROS Organics™
Brand: Acros Organics 168790250
Additional Details : CAS Number : 84-11-7 Weight : 0.07500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 25g |
Chemical Identifiers
| 84-11-7 | |
| 208.22 | |
| YYVYAPXYZVYDHN-UHFFFAOYSA-N | |
| 6763 | |
| phenanthrene-9,10-dione |
| C14H8O2 | |
| MFCD00001163 | |
| 9,10-phenanthrenequinone, phenanthrenequinone, 9,10-phenanthrenedione, 9,10-phenanthraquinone, phenanthraquinone, 9,10-phenanthroquinone, 9-10 phenanthrene quinone, unii-42l7bz8h74, ccris 7615, phenanthrene, 9,10-dihydro-9,10-dioxo | |
| CHEBI:37454 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O |
Specifications
| Phenanthrenequinone | |
| Authentic | |
| 360°C | |
| 201°C to 211°C | |
| 95% | |
| 94% min. (HPLC) | |
| MFCD00001163 | |
| 01,827; 02,317 | |
| 9,10-phenanthrenequinone, phenanthrenequinone, 9,10-phenanthrenedione, 9,10-phenanthraquinone, phenanthraquinone, 9,10-phenanthroquinone, 9-10 phenanthrene quinone, unii-42l7bz8h74, ccris 7615, phenanthrene, 9,10-dihydro-9,10-dioxo | |
| YYVYAPXYZVYDHN-UHFFFAOYSA-N | |
| phenanthrene-9,10-dione | |
| 6763 | |
| 208.22 | |
| 95% |
| 245°C | |
| Glass bottle | |
| Brown-Orange | |
| 25g | |
| 84-11-7 | |
| C14H8O2 | |
| 07, 796 | |
| 15, 7327 | |
| Solubility in water: practically insoluble. Other solubilities: soluble in glacial acetic acid,soluble in benzene,ether and hot alchol | |
| C1=CC=C2C(=C1)C3=CC=CC=C3C(=O)C2=O | |
| 208.22 | |
| CHEBI:37454 | |
| Powder |
Safety and Handling
- Phenanthrenequinone
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
- Specific target organ toxicity Category 3
Hazard Statement
- H319-Causes serious eye irritation.
- H335-May cause respiratory irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.