Få mere at vide
Nimodipine, 98+%, Thermo Scientific™
Potent L-type calcium channel antagonist
Brand: Thermo Scientific Alfa Aesar J61287.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 66085-59-4 | |
| 418.45 | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 4497 | |
| 3-(2-methoxyethyl) 5-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| C21H26N2O7 | |
| MFCD00153848 | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| CHEBI:7575 | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C |
Tekniske data
| Nimodipine | |
| C21H26N2O7 | |
| 1g | |
| nimodipine, nimotop, periplum, nimodipino, nimodipinum, nymalize, admon, nimodipinum inn-latin, nimodipino inn-spanish, isopropyl 2-methoxyethyl 1,4-dihydro-2,6-dimethyl-4-m-nitrophenyl-3,5-pyridinedicarboxylate | |
| COCCOC(=O)C1=C(C)NC(C)=C(C1C1=CC=CC(=C1)[N+]([O-])=O)C(=O)OC(C)C | |
| 418.45 | |
| CHEBI:7575 | |
| ≥98% |
| 66085-59-4 | |
| MFCD00153848 | |
| 14,6551 | |
| UIAGMCDKSXEBJQ-UHFFFAOYNA-N | |
| 3-(2-methoxyethyl) 5-propan-2-yl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate | |
| 4497 | |
| 418.44 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.