Learn More
Nickel phthalocyanine, 95%, ACROS Organics™
Brand: Acros Organics 415600050
Additional Details : CAS Number : 14055-02-8 Weight : 0.00500kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 5g |
Chemical Identifiers
| 14055-02-8 | |
| 571.21 | |
| LVIYYTJTOKJJOC-UHFFFAOYSA-N | |
| 2735100 |
| C32H16N8Ni | |
| MFCD00041954 | |
| nickel phthalocyanine, nickel ii phthalocyanine, phthalocyanine, ni, nickel ii phthalocyanine, dye content 85 % | |
| C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Ni+2] |
Specifications
| Nickel phthalocyanine | |
| Glass bottle | |
| 5g | |
| 14055-02-8 | |
| 100.0 | |
| C32H16N8Ni | |
| nickel phthalocyanine, nickel ii phthalocyanine, phthalocyanine, ni, nickel ii phthalocyanine, dye content 85 % | |
| C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.[Ni+2] | |
| 2735100 | |
| Crystalline Powder |
| Authentic | |
| Blue | |
| 95% | |
| 94.0 | |
| 95% | |
| MFCD00041954 | |
| LVIYYTJTOKJJOC-UHFFFAOYSA-N | |
| 571.21 | |
| 571.21 | |
| 95% |
Safety and Handling
- Nickel phthalocyanine
Signal Word
- Danger
Hazard Category
- Carcinogenicity Category 2
- Respiratory sensitiser Category 1
- Skin sensitiser Category 1
Hazard Statement
- H317-May cause an allergic skin reaction.
- H351-Suspected of causing cancer.
- H334-May cause allergy or asthma symptoms or breathing difficulties if inhaled.
Precautionary Statement
- P261-Avoid breathing dust/fume/gas/mist/vapours/spray.
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P342+P311-If experiencing respiratory symptoms: Call a POISON CENTER/doctor/ .