Få mere at vide
Naltrexone hydrochloride, Thermo Scientific™
A congener of naloxone and also an opioid antagonist
Brand: Thermo Scientific Alfa Aesar J60590.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsA congener of naloxone and also an opioid antagonist.Naltrexone hydrochloride is used in the treatment of alcohol and utilized for deceasing drinking habit. It is also used to prevent euphorigenic effects in the treatment of patients addicted to opioids. Further, it is used as a specific opiate antagonist.
Solubility
Soluble in water at 50mg/ml.
Notes
Light sensitive. Incompatible with bases and oxidizing agents. Store in a cool place.
Kemiske identifikatorer
| 16676-29-2 | |
| 377.865 | |
| RHBRMCOKKKZVRY-ITLPAZOVSA-N | |
| 5485201 | |
| C1CC1CN2CCC34C5C(=O)CCC3(C2CC6=C4C(=C(C=C6)O)O5)O.Cl |
| C20H24ClNO4 | |
| MFCD00069324 | |
| naltrexone hydrochloride, naltrexone hcl, trexan, depade, antaxone, revia, nalorex, unii-z6375yw9sf, nemexin | |
| (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one;hydrochloride |
Tekniske data
| Naltrexone hydrochloride | |
| C20H24ClNO4 | |
| 1g | |
| Light sensitive | |
| naltrexone hydrochloride, naltrexone hcl, trexan, depade, antaxone, revia, nalorex, unii-z6375yw9sf, nemexin | |
| RHBRMCOKKKZVRY-ITLPAZOVSA-N | |
| (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one;hydrochloride | |
| 5485201 |
| 16676-29-2 | |
| MFCD00069324 | |
| 3580333 | |
| 14,6363 | |
| Soluble in water at 50mg/ml. | |
| C1CC1CN2CCC34C5C(=O)CCC3(C2CC6=C4C(=C(C=C6)O)O5)O.Cl | |
| 377.865 | |
| 377.86 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.