missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Naftopidil hydrochloride, 98+%, Thermo Scientific™
An alpha1-adrenoceptor antagonist
Brand: Thermo Scientific Alfa Aesar J63249.MA
| Mængde | 10mg |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 1164469-60-6 | |
| 428.957 | |
| VQAAEWMEVIOHTJ-UHFFFAOYSA-N | |
| 6603044 | |
| COC1=CC=CC=C1N2CCN(CC2)CC(COC3=CC=CC4=CC=CC=C43)O.Cl |
| C24H29ClN2O3 | |
| MFCD09971016 | |
| naftopidil hydrochloride, opera_id_518, 1-4-2-methoxyphenyl piperazin-1-yl-3-naphthalen-1-yloxypropan-2-ol hydrochloride, 4-2-methoxyphenyl-?-1-naphthalenyloxy methyl-1-piperazineethanol hydrochloride | |
| 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride |
Tekniske data
| Naftopidil hydrochloride | |
| C24H29ClN2O3 | |
| 10mg | |
| Soluble in DMSO; Also soluble in ethanol; Insoluble in water. | |
| COC1=CC=CC=C1N2CCN(CC2)CC(COC3=CC=CC4=CC=CC=C43)O.Cl | |
| 428.957 | |
| 428.96 |
| 1164469-60-6 | |
| MFCD09971016 | |
| naftopidil hydrochloride, opera_id_518, 1-4-2-methoxyphenyl piperazin-1-yl-3-naphthalen-1-yloxypropan-2-ol hydrochloride, 4-2-methoxyphenyl-?-1-naphthalenyloxy methyl-1-piperazineethanol hydrochloride | |
| VQAAEWMEVIOHTJ-UHFFFAOYSA-N | |
| 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-naphthalen-1-yloxypropan-2-ol;hydrochloride | |
| 6603044 | |
| ≥98% |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?