Learn More
Alfa Aesar™ N-Fmoc-L-propargylglycine, 95%
Brand: Alfa Aesar™ H52171.MD
Additional Details : CAS Number : 198561-07-8 Weight : 0.00025kg
| Quantity | 250mg |
|---|
Description
ApplicationsFmoc-propargyl-Gly-OH is an Fmoc protected glycine derivative useful for solid phase peptide synthesis techniques. This compound could be useful as an unusual amino acid analog to aid in the deconvolution of protein structure and function. N-Fmoc-L-propargylglycine is a non-natural amino acids used for the triazole cross-link.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents. Store at 4°C.
Chemical Identifiers
| 198561-07-8 | |
| 335.359 | |
| DJGMNCKHNMRKFM-SFHVURJKSA-N | |
| 2734461 | |
| C#CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
| C20H17NO4 | |
| MFCD01075095 | |
| fmoc-l-propargylglycine, fmoc-pra-oh, fmoc-propargyl-gly-oh, s-2-fmoc-amino-4-pentynoic acid, s-n-fmoc-2-2'-propynyl glycine, 2s-2-9h-fluoren-9-ylmethoxycarbonylamino pent-4-ynoic acid, 2s-2-9h-fluoren-9-ylmethoxy carbonyl amino pent-4-ynoic acid, s-2-9h-fluoren-9-yl methoxy carbonyl amino pent-4-ynoic acid, 4-pentynoic acid, 2-9h-fluoren-9-ylmethoxy carbonyl amino-, 2s, 4-pentynoicacid, 2-9h-fluoren-9-ylmethoxy carbonyl amino-, 2s | |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid |
Specifications
| N-Fmoc-L-propargylglycine | |
| 198561-07-8 | |
| MFCD01075095 | |
| fmoc-l-propargylglycine, fmoc-pra-oh, fmoc-propargyl-gly-oh, s-2-fmoc-amino-4-pentynoic acid, s-n-fmoc-2-2'-propynyl glycine, 2s-2-9h-fluoren-9-ylmethoxycarbonylamino pent-4-ynoic acid, 2s-2-9h-fluoren-9-ylmethoxy carbonyl amino pent-4-ynoic acid, s-2-9h-fluoren-9-yl methoxy carbonyl amino pent-4-ynoic acid, 4-pentynoic acid, 2-9h-fluoren-9-ylmethoxy carbonyl amino-, 2s, 4-pentynoicacid, 2-9h-fluoren-9-ylmethoxy carbonyl amino-, 2s | |
| C#CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 | |
| 335.359 | |
| 335.36 |
| 250mg | |
| C20H17NO4 | |
| 9151699 | |
| DJGMNCKHNMRKFM-SFHVURJKSA-N | |
| (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pent-4-ynoic acid | |
| 2734461 | |
| 95% |