Learn More
Alfa Aesar™ N-Boc-trans-4-hydroxy-L-proline methyl ester, 97%
Brand: Alfa Aesar™ H59027.06
Additional Details : CAS Number : 74844-91-0 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
ApplicationsIt is used in the synthesis of For-Met-Leu-Phe-OMe (fMLF-OMe) analogues based on Met residue replacement by 4-amino-proline scaffold.
Solubility
Soluble in chloroform, dichloromethane and ethyl acetate.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from oxidizing agent.
Chemical Identifiers
| 74844-91-0 | |
| 245.275 | |
| MZMNEDXVUJLQAF-SFYZADRCSA-N | |
| 2734883 | |
| CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)O |
| C11H19NO5 | |
| MFCD00076981 | |
| boc-hyp-ome, n-boc-trans-4-hydroxy-l-proline methyl ester, 2s,4r-1-tert-butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 1-tert-butyl 2-methyl 2s,4r-4-hydroxypyrrolidine-1,2-dicarboxylate, boc-l-hydroxyproline methyl ester, boc-hydroxyproline-ome, methyl trans-1-boc-4-hydroxy-l-prolinate, n-tert-butoxycarbonyl-trans-4-hydroxy-l-proline methyl ester, trans-1-tert-butoxycarbonyl-4-hydroxy-l-proline methyl ester, n-boc-trans-4-hydroxyl-l-proline methyl ester | |
| 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate |
Specifications
| N-Boc-trans-4-hydroxy-L-proline methyl ester | |
| 92°C to 96°C | |
| 74844-91-0 | |
| MFCD00076981 | |
| Soluble in chloroform,dichloromethane and ethyl acetate. | |
| CC(C)(C)OC(=O)N1CC(CC1C(=O)OC)O | |
| 245.275 | |
| 245.28 |
| −65° (c=1 in Chloroform) | |
| 5g | |
| C11H19NO5 | |
| boc-hyp-ome, n-boc-trans-4-hydroxy-l-proline methyl ester, 2s,4r-1-tert-butyl 2-methyl 4-hydroxypyrrolidine-1,2-dicarboxylate, 1-tert-butyl 2-methyl 2s,4r-4-hydroxypyrrolidine-1,2-dicarboxylate, boc-l-hydroxyproline methyl ester, boc-hydroxyproline-ome, methyl trans-1-boc-4-hydroxy-l-prolinate, n-tert-butoxycarbonyl-trans-4-hydroxy-l-proline methyl ester, trans-1-tert-butoxycarbonyl-4-hydroxy-l-proline methyl ester, n-boc-trans-4-hydroxyl-l-proline methyl ester | |
| MZMNEDXVUJLQAF-SFYZADRCSA-N | |
| 1-O-tert-butyl 2-O-methyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate | |
| 2734883 | |
| 97% |