Learn More
Alfa Aesar™ N-Boc-N-methyl-L-serine, 98%
Brand: Alfa Aesar™ H63314.03
Additional Details : CAS Number : 101772-29-6 Weight : 0.00100kg
Quantity | 1g |
---|
Description
ApplicationsN-Boc-N-methyl-L-serine is used as a precursor in organic synthesis and pharmaceuticals.
Notes
Incompatible with strong oxidizing agents.
Chemical Identifiers
101772-29-6 | |
219.237 | |
NJQGIDVCNBZXLG-LURJTMIESA-N | |
7009594 | |
CC(C)(C)OC(=O)N(C)C(CO)C(=O)O |
C9H17NO5 | |
MFCD00037249 | |
boc-n-me-ser-oh, boc-l-meser-oh, boc-n-methyl-l-serine, boc-n-a-methyl-l-serine, boc-n-, a-methyl-l-serine, s-2-tert-butoxycarbonyl methyl amino-3-hydroxypropanoic acid, n-boc-n-methyl-l-serine, l-serine,n-1,1-dimethylethoxy carbonyl-n-methyl, boc-meser-oh, 2s-2-tert-butoxycarbonyl methyl amino-3-hydroxypropanoic acid | |
(2S)-3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
Specifications
N-Boc-N-methyl-L-serine | |
C9H17NO5 | |
8685334 | |
NJQGIDVCNBZXLG-LURJTMIESA-N | |
(2S)-3-hydroxy-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid | |
7009594 | |
Solid | |
83°C to 87°C |
101772-29-6 | |
MFCD00037249 | |
boc-n-me-ser-oh, boc-l-meser-oh, boc-n-methyl-l-serine, boc-n-a-methyl-l-serine, boc-n-, a-methyl-l-serine, s-2-tert-butoxycarbonyl methyl amino-3-hydroxypropanoic acid, n-boc-n-methyl-l-serine, l-serine,n-1,1-dimethylethoxy carbonyl-n-methyl, boc-meser-oh, 2s-2-tert-butoxycarbonyl methyl amino-3-hydroxypropanoic acid | |
CC(C)(C)OC(=O)N(C)C(CO)C(=O)O | |
219.237 | |
219.23 | |
98% | |
1g |