missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Alfa Aesar™ N,1-Di-Boc-L-histidine dicyclohexylammonium salt, 98%
Brand: Alfa Aesar™ H62570.06
Additional Details : Weight : 0.00500kg
| Quantity | 5g |
|---|
Chemical Identifiers
| 31687-58-8 | |
| 536.714 | |
| WBGMQHNUPJENDC-MERQFXBCSA-N | |
| 16211319 | |
| CC(C)(C)OC(=O)NC(CC1=CN(C=N1)C(=O)OC(C)(C)C)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
| C28H48N4O6 | |
| MFCD06804675 | |
| boc-his boc-oh.dcha, boc-his boc-oh dcha, boc-his boc-ohdcha, boc-his boc .dcha, n,1-bis tert-butoxycarbonyl-l-histidine, compound with dicyclohexylamine 1:1, pubchem18934, n,1-bis boc-l-histidine dicyclohexylamine salt, boc-his boc-ohcha, boc-his boc-oh?cha, boc-his boc-oh toluene solvate | |
| N-cyclohexylcyclohexanamine;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid |
Specifications
| N,1-Di-Boc-L-histidine dicyclohexylammonium salt | |
| C28H48N4O6 | |
| boc-his boc-oh.dcha, boc-his boc-oh dcha, boc-his boc-ohdcha, boc-his boc .dcha, n,1-bis tert-butoxycarbonyl-l-histidine, compound with dicyclohexylamine 1:1, pubchem18934, n,1-bis boc-l-histidine dicyclohexylamine salt, boc-his boc-ohcha, boc-his boc-oh?cha, boc-his boc-oh toluene solvate | |
| CC(C)(C)OC(=O)NC(CC1=CN(C=N1)C(=O)OC(C)(C)C)C(=O)O.C1CCC(CC1)NC2CCCCC2 | |
| 536.714 | |
| 536.7 | |
| 98% | |
| 5g |
| 31687-58-8 | |
| MFCD06804675 | |
| WBGMQHNUPJENDC-MERQFXBCSA-N | |
| N-cyclohexylcyclohexanamine;(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-4-yl]propanoic acid | |
| 16211319 | |
| Solid | |
| 160°C to 165°C (decomposition) |