Learn More
Alfa Aesar™ Mycophenolic acid, 98%
Brand: Alfa Aesar™ J61905.09
Additional Details : CAS Number : 24280-93-1 Weight : 0.01000kg
| Quantity | 10g |
|---|
Description
ApplicationsIt is used as a small molecule IMPDH inhibitor. mycophenolic Acid is used as an immunosuppressive agent with antiviral and antitumor effects. It potently inhibits inosine monophosphate dehydrogenase, thus inhibiting de novo GTP synthesis leading to decreased RNA and DNA synthesis. It also reversibly inhibits proliferation of T and B lymphocytes and antibody formation.
Solubility
Soluble in methanol at 50mg/ml
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Recommended storage temperature: 2 - 8°C. Keep away from strong oxidizing agent.
Chemical Identifiers
| 24280-93-1 | |
| 320.341 | |
| HPNSFSBZBAHARI-RUDMXATFSA-N | |
| 446541 | |
| (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |
| C17H20O6 | |
| MFCD00036814 | |
| mycophenolic acid, mycophenolate, melbex, myfortic, mycophenolsaeure, acido micofenolico, micofenolico acido, acide mycophenolique, acidum mycophenolicum, 6-4-hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl-4-methyl-4-hexenoic acid | |
| CHEBI:168396 | |
| CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)O)OC |
Specifications
| Mycophenolic acid | |
| 139°C to 141°C | |
| 24280-93-1 | |
| MFCD00036814 | |
| 14,6327 | |
| Soluble in methanol at 50mg/ml | |
| CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)O)OC | |
| 320.341 | |
| CHEBI:168396 | |
| Powder |
| White | |
| 10g | |
| C17H20O6 | |
| 1295848 | |
| mycophenolic acid, mycophenolate, melbex, myfortic, mycophenolsaeure, acido micofenolico, micofenolico acido, acide mycophenolique, acidum mycophenolicum, 6-4-hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl-4-methyl-4-hexenoic acid | |
| HPNSFSBZBAHARI-RUDMXATFSA-N | |
| (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid | |
| 446541 | |
| 320.34 | |
| 98% |