Learn More
Methyl 3,4,5-trihydroxybenzoate, 99%, ACROS Organics™
Brand: Acros Organics 243460500
Additional Details : CAS Number : 99-24-1 Weight : 0.10000kg
| Packaging | Plastic bottle |
|---|---|
| Quantity | 50g |
Chemical Identifiers
| 99-24-1 | |
| 184.15 | |
| FBSFWRHWHYMIOG-UHFFFAOYSA-N | |
| 7428 | |
| COC(=O)C1=CC(=C(C(=C1)O)O)O |
| C8H8O5 | |
| MFCD00002194 | |
| methyl gallate, gallic acid methyl ester, methylgallate, benzoic acid, 3,4,5-trihydroxy-, methyl ester, gallic acid, methyl ester, methyl galloate, unii-623d3xg80c, ccris 5567, 3,4,5-trihydroxybenzoic acid methyl ester, chembl65675 | |
| methyl 3,4,5-trihydroxybenzoate |
Specifications
| Methyl 3,4,5-trihydroxybenzoate | |
| Plastic bottle | |
| 199°C to 203°C | |
| 99-24-1 | |
| C8H8O5 | |
| 15, 4375 | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in alcohol,methanol,ether | |
| COC(=O)C1=CC(=C(C(=C1)O)O)O | |
| 184.15 | |
| 184.15 | |
| 99% |
| Authentic | |
| White to Beige | |
| 50g | |
| 98.5% min. (HPLC) | |
| MFCD00002194 | |
| methyl gallate, gallic acid methyl ester, methylgallate, benzoic acid, 3,4,5-trihydroxy-, methyl ester, gallic acid, methyl ester, methyl galloate, unii-623d3xg80c, ccris 5567, 3,4,5-trihydroxybenzoic acid methyl ester, chembl65675 | |
| FBSFWRHWHYMIOG-UHFFFAOYSA-N | |
| methyl 3,4,5-trihydroxybenzoate | |
| 7428 | |
| Crystalline Powder |
Safety and Handling
- Methyl 3,4,5-trihydroxybenzoate
Signal Word
- Warning
Hazard Category
- Acute toxicity Category 4
Hazard Statement
- H302-Harmful if swallowed.
Precautionary Statement
- P301+P312-IF SWALLOWED: Call a POISON CENTER or doctor/physician/ if you feel unwell.