Learn More
Alfa Aesar™ Methyl hydrogen terephthalate, 99+%
Brand: Alfa Aesar™ H54391.06
Additional Details : CAS Number : 1679-64-7 Weight : 0.00500kg
| Quantity | 5g |
|---|
Description
ApplicationsMethyl hydrogen terephthalate is used in the synthesis of Hepatitis C antiviral activity. It is also used in the design and preparation of benzamide derivatives as BRAFV600E inhibitors.
Solubility
Slightly soluble in water. Also soluble in methanol, benzene and ether.
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents.
Chemical Identifiers
| 1679-64-7 | |
| 180.159 | |
| REIDAMBAPLIATC-UHFFFAOYSA-N | |
| 15513 | |
| COC(=O)C1=CC=C(C=C1)C(=O)O |
| C9H8O4 | |
| MFCD00002557 | |
| 4-methoxycarbonyl benzoic acid, mono-methyl terephthalate, monomethyl terephthalate, methyl terephthalate, methyl hydrogen terephthalate, 1,4-benzenedicarboxylic acid, monomethyl ester, terephthalic acid monomethyl ester, 1,4-benzenedicarboxylic acid monomethyl ester, terephthalic acid, monomethyl ester, hydrogen methyl terephthalate | |
| 4-methoxycarbonylbenzoic acid |
Specifications
| Methyl hydrogen terephthalate | |
| 5g | |
| C9H8O4 | |
| 1911082 | |
| Slightly soluble in water. Also soluble in methanol,benzene and ether. | |
| COC(=O)C1=CC=C(C=C1)C(=O)O | |
| 180.159 | |
| 180.16 |
| 220°C to 223°C | |
| 1679-64-7 | |
| MFCD00002557 | |
| 4-methoxycarbonyl benzoic acid, mono-methyl terephthalate, monomethyl terephthalate, methyl terephthalate, methyl hydrogen terephthalate, 1,4-benzenedicarboxylic acid, monomethyl ester, terephthalic acid monomethyl ester, 1,4-benzenedicarboxylic acid monomethyl ester, terephthalic acid, monomethyl ester, hydrogen methyl terephthalate | |
| REIDAMBAPLIATC-UHFFFAOYSA-N | |
| 4-methoxycarbonylbenzoic acid | |
| 15513 | |
| ≥99% |