Learn More
Alfa Aesar™ Methyl 2-amino-5-methoxybenzoate, 96%
Brand: Alfa Aesar™ H54704.03
Additional Details : CAS Number : 2475-80-1 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
ApplicationsIt is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuffs.
Solubility
Slightly Soluble (1.1 g/L) (25°C) in water.
Notes
Store at room temperature. Keep away from oxidizing agents and acids. Moisture sensitive.
Chemical Identifiers
| 2475-80-1 | |
| 181.191 | |
| MOVBJUGHBJJKOW-UHFFFAOYSA-N | |
| 13052275 | |
| COC1=CC(=C(C=C1)N)C(=O)OC |
| C9H11NO3 | |
| MFCD09038482 | |
| benzoic acid, 2-amino-5-methoxy-, methyl ester, methyl2-amino-5-methoxybenzoate, 2-amino-5-methoxybenzoic acid methyl ester, methyl 5-methoxyanthranilate, benzoic acid,2-amino-5-methoxy-, methyl ester, methyl 6-amino-m-anisate, acmc-1cnv1, intermediates-zcf02665, 2-amino-5-methoxybenzoic acid,methyl ester, 2-amino-5-methoxy-benzoic acid methyl ester | |
| methyl 2-amino-5-methoxybenzoate |
Specifications
| Methyl 2-amino-5-methoxybenzoate | |
| 1g | |
| C9H11NO3 | |
| benzoic acid, 2-amino-5-methoxy-, methyl ester, methyl2-amino-5-methoxybenzoate, 2-amino-5-methoxybenzoic acid methyl ester, methyl 5-methoxyanthranilate, benzoic acid,2-amino-5-methoxy-, methyl ester, methyl 6-amino-m-anisate, acmc-1cnv1, intermediates-zcf02665, 2-amino-5-methoxybenzoic acid,methyl ester, 2-amino-5-methoxy-benzoic acid methyl ester | |
| MOVBJUGHBJJKOW-UHFFFAOYSA-N | |
| methyl 2-amino-5-methoxybenzoate | |
| 13052275 | |
| 96% |
| 32°C to 33°C | |
| 2475-80-1 | |
| MFCD09038482 | |
| Slightly Soluble (1.1g/L) (25°C) in water. | |
| COC1=CC(=C(C=C1)N)C(=O)OC | |
| 181.191 | |
| 181.19 |