Få mere at vide
Meloxicam, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar J60635.14
| Mængde | 25g |
|---|
Se flere versioner af dette produkt
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
SolubilitySoluble in water (22 mg/ml), DMSO (25 mg/ml), DMF, acetone(slightly soluble), ethanol(slightly soluble), and methanol(slightly soluble).
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents, heat.
Chemical Identifiers
| 71125-38-7 | |
| 351.40 | |
| DWMREKMVXIFPFM-ACCUITESSA-N | |
| 54677470 | |
| (3E)-3-{hydroxy[(5-methyl-1,3-thiazol-2-yl)amino]methylidene}-2-methyl-3,4-dihydro-2H-1λ⁶,2-benzothiazine-1,1,4-trione |
| C14H13N3O4S2 | |
| MFCD00868752 | |
| meloxicam, mobic, metacam, movalis, meloxicamum, mobicox, mobec, meloxicam mobic, movatec, parocin | |
| CHEBI:6741 | |
| CN1\C(=C(\O)NC2=NC=C(C)S2)C(=O)C2=CC=CC=C2S1(=O)=O |
Specifications
| Meloxicam | |
| C14H13N3O4S2 | |
| 25g | |
| 14,5826 | |
| Soluble in water (22mg/ml),DMSO (25mg/ml),DMF,acetone(slightly soluble),ethanol(slightly soluble),and methanol(slightly soluble). | |
| CN1\C(=C(\O)NC2=NC=C(C)S2)C(=O)C2=CC=CC=C2S1(=O)=O | |
| 351.40 | |
| CHEBI:6741 |
| 71125-38-7 | |
| MFCD00868752 | |
| UN2811 | |
| meloxicam, mobic, metacam, movalis, meloxicamum, mobicox, mobec, meloxicam mobic, movatec, parocin | |
| DWMREKMVXIFPFM-ACCUITESSA-N | |
| (3E)-3-{hydroxy[(5-methyl-1,3-thiazol-2-yl)amino]methylidene}-2-methyl-3,4-dihydro-2H-1λ⁶,2-benzothiazine-1,1,4-trione | |
| 54677470 | |
| 351.39 |
Your input is important to us. Please complete this form to provide feedback related to the content on this product.