Få mere at vide
Lovastatin, 97%, Thermo Scientific™
Brand: Thermo Scientific Alfa Aesar H52792.14
| Mængde | 25g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsLovastatin is a cholesterol lowering drug and competitive inhibitor of HMG-CoA reductase, a rate limiting enzyme in cholesterol synthesis. Blocks the production of mevalonate, a critical compound in the production of cholesterol and isoprenoids. It increases cellular resistance to anticancer agents such as doxorubicin and induces apoptosis in myeloma cells. It causes cell cycle arrest in G1 and G2/M phases.
Solubility
Soluble in DMSO (10 mg/ml), ethanol (10 mg/ml), methanol, chloroform, acetone, acetonitrile, DMF, and water (0.4 µg/ml).
Notes
Stable under recommended storage conditions. Incompatible with oxidizing agents and heat.
Kemiske identifikatorer
| 75330-75-5 | |
| 404.55 | |
| PCZOHLXUXFIOCF-BXMDZJJMSA-N | |
| 53232 | |
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate |
| C24H36O5 | |
| MFCD00072164 | |
| lovastatin, mevinolin, mevacor, monacolin k, lovalip, altoprev, lovalord, mevinacor, nergadan, 6alpha-methylcompactin | |
| CHEBI:40303 | |
| CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 |
Tekniske data
| Lovastatin | |
| C24H36O5 | |
| 25g | |
| Soluble in DMSO (10mg/ml),ethanol (10mg/ml),methanol,chloroform,acetone,acetonitrile,DMF,and water (0.4 μg/ml). | |
| CC[C@H](C)C(=O)O[C@H]1C[C@@H](C)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H]12 | |
| 404.55 | |
| CHEBI:40303 | |
| 97% |
| 75330-75-5 | |
| MFCD00072164 | |
| lovastatin, mevinolin, mevacor, monacolin k, lovalip, altoprev, lovalord, mevinacor, nergadan, 6alpha-methylcompactin | |
| PCZOHLXUXFIOCF-BXMDZJJMSA-N | |
| (1S,3R,7S,8S,8aR)-8-{2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl}-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl (2S)-2-methylbutanoate | |
| 53232 | |
| 404.56 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.