Learn More
Alfa Aesar™ L-Glutamine tert-butyl ester hydrochloride, 98%
Brand: Alfa Aesar™ H63868.03
Additional Details : CAS Number : 39741-62-3 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
ApplicationsReactant in the synthesis of rhenium-glutamine conjugates. It is mainly used in food and pharma industry.
Solubility
Soluble 0.3gram in 2ml water clear solution.
Notes
Store in cool place. Keep container tightly closed in a dry and well-ventilated place. Store away from strong oxidizing agents, acids, heat.
Chemical Identifiers
| 39741-62-3 | |
| 238.712 | |
| ZEPNUNKDKQACNC-RGMNGODLSA-N | |
| 15602445 | |
| CC(C)(C)OC(=O)C(CCC(=O)N)N.Cl |
| C9H19ClN2O3 | |
| MFCD00039081 | |
| h-gln-otbu.hcl, l-glutamine t-butyl ester hydrochloride, h-gln-otbu hcl, s-tert-butyl 2,5-diamino-5-oxopentanoate hydrochloride, h-gln-otbu hydrochloride, l-glutamine tert-butyl ester hydrochloride, hggln-otbu hcl, gln-otbu.hcl, h-gln-otbucl, glutamine t-butyl ester hydrochloride | |
| tert-butyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride |
Specifications
| L-Glutamine tert-butyl ester hydrochloride | |
| C9H19ClN2O3 | |
| h-gln-otbu.hcl, l-glutamine t-butyl ester hydrochloride, h-gln-otbu hcl, s-tert-butyl 2,5-diamino-5-oxopentanoate hydrochloride, h-gln-otbu hydrochloride, l-glutamine tert-butyl ester hydrochloride, hggln-otbu hcl, gln-otbu.hcl, h-gln-otbucl, glutamine t-butyl ester hydrochloride | |
| ZEPNUNKDKQACNC-RGMNGODLSA-N | |
| tert-butyl (2S)-2,5-diamino-5-oxopentanoate;hydrochloride | |
| 15602445 | |
| Powder | |
| White |
| 39741-62-3 | |
| MFCD00039081 | |
| Soluble 0.3gram in 2ml water clear solution. | |
| CC(C)(C)OC(=O)C(CCC(=O)N)N.Cl | |
| 238.712 | |
| 238.71 | |
| 98% | |
| 1g |