Få mere at vide
Irinotecan hydrochloride, Thermo Scientific™
Topoisomerase I inhibitor
Brand: Thermo Scientific Alfa Aesar J60743.MF
| Mængde | 50mg |
|---|
Beschreibung
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemische Identifikatoren
| 100286-90-6 | |
| 623.15 | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| 74990 | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride |
| C33H39ClN4O6 | |
| MFCD01862255 | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| CHEBI:5971 | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O |
Spezifikation
| Irinotecan hydrochloride | |
| C33H39ClN4O6 | |
| 50mg | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride | |
| 74990 | |
| 623.14 |
| 100286-90-6 | |
| MFCD01862255 | |
| 14,5091 | |
| Soluble in DMSO or DMF at approximately 20mg/ml; Sparingly soluble in aqueous buffers; /n | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O | |
| 623.15 | |
| CHEBI:5971 |
Sicherheit und Handhabung
- Irinotecan hydrochloride
Signalwort
- Advarsel
Gefahrenkategorie
- Akut toksicitet Kategori 4
Gefahrenhinweis
- H302-Farlig ved indtagelse.
Sicherheitshinweis
- P264-Vask grundigt efter brug.
- P301+P330+P331-I TILFÆLDE AF INDTAGELSE: Skyl munden. Fremkald IKKE opkastning.
- P312-I tilfælde af ubehag, ring til en GIFTINFORMATION/læge/ .
Ergänzende Informationen
- MIXTURE LIST-Indeholder: Irinotecan hydrochloride
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.