Få mere at vide
Irinotecan hydrochloride, Thermo Scientific™
Topoisomerase I inhibitor
Brand: Thermo Scientific Alfa Aesar J60743.MD
| Mængde | 250mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 100286-90-6 | |
| 623.15 | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| 74990 | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride |
| C33H39ClN4O6 | |
| MFCD01862255 | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| CHEBI:5971 | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O |
Tekniske data
| Irinotecan hydrochloride | |
| C33H39ClN4O6 | |
| 250mg | |
| irinotecan hydrochloride, irinotecan hcl, topotecin, campto, cpt-11, cpt 11, camptothecin 11 hydrochloride, camptothecin 11, unii-06x131e4oe | |
| GURKHSYORGJETM-WAQYZQTGSA-N | |
| hydrogen (19S)-10,19-diethyl-19-hydroxy-14,18-dioxo-17-oxa-3,13-diazapentacyclo[11.8.0.0²,¹¹.0⁴,⁹.0¹⁵,²⁰]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaen-7-yl [1,4'-bipiperidine]-1'-carboxylate chloride | |
| 74990 | |
| 623.14 |
| 100286-90-6 | |
| MFCD01862255 | |
| 14,5091 | |
| Soluble in DMSO or DMF at approximately 20mg/ml; Sparingly soluble in aqueous buffers; /n | |
| [H+].[Cl-].CCC1=C2C=C(OC(=O)N3CCC(CC3)N3CCCCC3)C=CC2=NC2=C1CN1C2=CC2=C(COC(=O)[C@]2(O)CC)C1=O | |
| 623.15 | |
| CHEBI:5971 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.