Learn More
Guanine, 99+%, ACROS Organics™
Brand: Acros Organics 120251000
Additional Details : CAS Number : 73-40-5 Weight : 0.15000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 100g |
Chemical Identifiers
| 73-40-5 | |
| 151.13 | |
| UYTPUPDQBNUYGX-UHFFFAOYSA-N | |
| 764 | |
| 2-amino-3,7-dihydropurin-6-one |
| C5H5N5O | |
| MFCD00071533 | |
| guanine, 2-amino-6-hydroxypurine, guanin, 2-aminohypoxanthine, mearlmaid, pearl essence, guanine enol, stella polaris, dew pearl, natural pearl essence | |
| CHEBI:16235 | |
| C1=NC2=C(N1)C(=O)N=C(N2)N |
Specifications
| lambda max. 248nm, pH 1, 1.35 to 1.41 (A250/A260), 0.82 to 0.86 (A280/A260), 0.47 to 0.51 (A290/A260) | |
| 0.1% max. | |
| 0.5% max. | |
| 0.1% max | |
| 360°C | |
| 73-40-5 | |
| C5H5N5O | |
| 26, 449 | |
| guanine, 2-amino-6-hydroxypurine, guanin, 2-aminohypoxanthine, mearlmaid, pearl essence, guanine enol, stella polaris, dew pearl, natural pearl essence | |
| UYTPUPDQBNUYGX-UHFFFAOYSA-N | |
| 2-amino-3,7-dihydropurin-6-one | |
| 764 | |
| 151.13 | |
| 99+% |
| Guanine | |
| Authentic | |
| Glass bottle | |
| White to Cream | |
| 100g | |
| 99% min. (HPLC) | |
| MFCD00071533 | |
| 15, 4599 | |
| Solubility in water: practically insoluble. Other solubilities: freely soluble in alkali hydroxides,dilute acids,sparingly soluble in alcohol and ether | |
| C1=NC2=C(N1)C(=O)N=C(N2)N | |
| 151.13 | |
| CHEBI:16235 | |
| Powder |
Safety and Handling
- Guanine
Signal Word
- Warning
Hazard Category
- Serious eye damage/eye irritation Category 2
- Skin corrosion/irritation Category 2
Hazard Statement
- H319-Causes serious eye irritation.
- H315-Causes skin irritation.
Precautionary Statement
- P280-Wear protective gloves/protective clothing/eye protection/face protection.
- P302+P352-IF ON SKIN: Wash with plenty of water/.
- P305+P351+P338-IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.