Learn More
Glutathione, 98%, for analysis, reduced, ACROS Organics™
Brand: Acros Organics 120000050
Additional Details : CAS Number : 70-18-8 Weight : 0.05500kg
Quantity | 5g |
---|
Chemical Identifiers
70-18-8 | |
307.32 | |
RWSXRVCMGQZWBV-WDSKDSINSA-N | |
124886 | |
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
C10H17N3O6S | |
MFCD00065939 | |
glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
CHEBI:16856 | |
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
Specifications
Glutathione | |
0.5% max. (105°C, 3 hrs) | |
− 16.50 (20.00°C c=2,H2O) | |
0.1% max. (800°C) | |
182.0°C to 192.0°C | |
For analysis, Reduced | |
97.5% min. (Iodimetry) | |
MFCD00065939 | |
15,4511 | |
Solubility in water: very soluble. Other solubilities: freely soluble in dilute alcohol and dimethyl-, formamide, almost insoluble in ethanol | |
C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
307.32 | |
CHEBI:16856 | |
Crystalline Powder | |
Analysis |
Authentic | |
Glass bottle | |
− 16.50 | |
White | |
5g | |
70-18-8 | |
C10H17N3O6S | |
04,II,931 | |
glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
RWSXRVCMGQZWBV-WDSKDSINSA-N | |
(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
124886 | |
307.32 | |
98% |