Få mere at vide
Glufosinate ammonium, 95%, Thermo Scientific™
Glufosinate ammonium, 95%, CAS # 77182-82-2, also known as glufosinate, is a non-selective phosphorous herbicide.
Brand: Thermo Scientific Alfa Aesar J66186.MD
595.53 DKK valid until 2026-07-03
BEDSTE tilbudspris! Brug kampagnekoden "27965" for at få din tilbudspris.
| Mængde | 250mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
General Description
• Glufosinate ammonium is a compound which exhibits broad-spectrum herbicidal properties through inhibition of glutamine synthetase, which disrupts cell membranes
Application
• Glufosinate ammonium acts as a non-selective herbicide
Kemiske identifikatorer
| 77182-82-2 | |
| 198.16 | |
| ZBMRKNMTMPPMMK-UHFFFAOYNA-N | |
| 122130249 | |
| [NH4+].CP(O)(=O)CCC(N)C([O-])=O |
| C5H15N2O4P | |
| MFCD00055562,MFCD00211362 | |
| DL-Phosphinothricin; 2-Amino-4-(hydroxymethylphosphinyl)butyric acid ammonium salt | |
| ammonium 2-amino-4-[hydroxy(methyl)phosphoryl]butanoate |
Tekniske data
| Glufosinate ammonium | |
| White | |
| >110°C (230°F) | |
| MFCD00055562,MFCD00211362 | |
| 519°C | |
| DL-Phosphinothricin; 2-Amino-4-(hydroxymethylphosphinyl)butyric acid ammonium salt | |
| ZBMRKNMTMPPMMK-UHFFFAOYNA-N | |
| ammonium 2-amino-4-[hydroxy(methyl)phosphoryl]butanoate | |
| 122130249 | |
| 95% |
| 77182-82-2 | |
| 250mg | |
| C5H15N2O4P | |
| 8163399 | |
| 14,7339 | |
| Soluble in water | |
| [NH4+].CP(O)(=O)CCC(N)C([O-])=O | |
| 198.16 | |
| 198.16 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.