missing translation for 'onlineSavingsMsg'
Få mere at vide
Få mere at vide
Fluoxetine hydrochloride, 99%, Thermo Scientific™
A selective serotonin reuptake inhibitor
Brand: Thermo Scientific Alfa Aesar J61197.MD
| Mængde | 250mg |
|---|
Denne vare kan ikke returneres.
Se returpolitik
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFluoxetine hydrochloride is a selective serotonin reuptake inhibitor. It is used to treat major depressive disorder, bulimia nervosa (an eating disorder) obsessive-compulsive disorder, panic disorder and premenstrual dysphoric disorder (PMDD).
Solubility
Soluble in dimethylsulfoxide and water.
Notes
Incompatible with strong oxidizing agents.
Kemiske identifikatorer
| 56296-78-7 | |
| 345.79 | |
| GIYXAJPCNFJEHY-UHFFFAOYSA-N | |
| 62857 | |
| CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl |
| C17H19ClF3NO | |
| MFCD00214288 | |
| fluoxetine hydrochloride, prozac, fluoxetine hcl, sarafem, flunirin, fluoxeren, adofen, fluctin, lovan | |
| N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride |
Tekniske data
| Fluoxetine hydrochloride | |
| C17H19ClF3NO | |
| 250mg | |
| fluoxetine hydrochloride, prozac, fluoxetine hcl, sarafem, flunirin, fluoxeren, adofen, fluctin, lovan | |
| GIYXAJPCNFJEHY-UHFFFAOYSA-N | |
| N-methyl-3-phenyl-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;hydrochloride | |
| 62857 | |
| 99% |
| 56296-78-7 | |
| MFCD00214288 | |
| 14,4185 | |
| Soluble in dimethylsulfoxide and water. | |
| CNCCC(C1=CC=CC=C1)OC2=CC=C(C=C2)C(F)(F)F.Cl | |
| 345.79 | |
| 345.79 |
Produkttitel
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.
Ser du en mulighed for forbedring?