Learn More
Alfa Aesar™ Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate, 98%
Brand: Alfa Aesar™ H54910.03
Additional Details : CAS Number : 164298-23-1 Weight : 0.00100kg
| Quantity | 1g |
|---|
Description
ApplicationsFluoro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate is used as a reagent for synthesis of cationic antimicrobial β-2,2-amino acid derivatives, philanthotoxin analogues for inhibition of the ionotropic glutamate receptor, small β-peptidomimetics for antimicrobials and hydrazone ligation to assemble multifunctional viral nanoparticles.
Solubility
Soluble in water.
Notes
Keep container tightly sealed. Store in cool, dry conditions in well sealed containers. Incompatible with oxidizing agents.
Chemical Identifiers
| 164298-23-1 | |
| 264.128 | |
| ZAVXOOLKAGPJPI-UHFFFAOYSA-N | |
| 2774761 | |
| CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F |
| C5H12F7N2P | |
| MFCD02684443 | |
| tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, n-dimethylamino fluoromethylene-n-methylmethanaminium hexafluorophosphate v, tetramethyl fluoroformamidium hexafluoro phosphate, n,n,n',n'-tetramethylfluoroformamidinium hexafluorophosphate, tetramethylfluoroformamidinium hexafluorophosphate, tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, c5h12fn2.f6p, acmc-209dqu, tetramethyl fluoroformamidium hexafluorophosphate | |
| [dimethylamino(fluoro)methylidene]-dimethylazanium;hexafluorophosphate |
Specifications
| Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate | |
| 1g | |
| C5H12F7N2P | |
| tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, n-dimethylamino fluoromethylene-n-methylmethanaminium hexafluorophosphate v, tetramethyl fluoroformamidium hexafluoro phosphate, n,n,n',n'-tetramethylfluoroformamidinium hexafluorophosphate, tetramethylfluoroformamidinium hexafluorophosphate, tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, c5h12fn2.f6p, acmc-209dqu, tetramethyl fluoroformamidium hexafluorophosphate | |
| ZAVXOOLKAGPJPI-UHFFFAOYSA-N | |
| [dimethylamino(fluoro)methylidene]-dimethylazanium;hexafluorophosphate | |
| 2774761 | |
| 98% |
| 104°C to 111°C | |
| 164298-23-1 | |
| MFCD02684443 | |
| Soluble in water. | |
| CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F | |
| 264.128 | |
| 264.12 |