Learn More
Ficoll 400 (White to Off-White Powder/Molecular Biology), Fisher BioReagents
Brand: Fisher Bioreagents BP525-100
Additional Details : CAS Number : 26873-85-8 Weight : 0.15000kg
| Packaging | Poly Bottle |
|---|---|
| Quantity | 100g |
Description
Ficoll 400 is used as a component of Denhardt's Reagent and in gel-loading buffers for DNA gels. It is also used in forming density gradients to separate cells and subcellular components.Chemical Identifiers
| 26873-85-8 | |
| 434.819 | |
| ficol 400 | |
| 2-(chloromethyl)oxirane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| C15H27ClO12 | |
| IACFXVUNKCXYJM-AKSHDPDZSA-N | |
| 88330506 | |
| C1C(O1)CCl.C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O |
Specifications
| Ficoll™ 400 | |
| DNase free | |
| ficol 400 | |
| C1C(O1)CCl.C(C1C(C(C(C(O1)OC2(C(C(C(O2)CO)O)O)CO)O)O)O)O | |
| 434.819 | |
| ≈400,000 | |
| Molecular Biology | |
| Protease free | |
| White |
| 26873-85-8 | |
| C15H27ClO12 | |
| IACFXVUNKCXYJM-AKSHDPDZSA-N | |
| 2-(chloromethyl)oxirane;(2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol | |
| 88330506 | |
| Powder/Solid | |
| Poly Bottle | |
| Inclusive between 50° (+ or -) | |
| 100g |