Få mere at vide
Fexofenadine hydrochloride, Thermo Scientific™
H-1 receptor antagonist
Brand: Thermo Scientific Alfa Aesar J63262.MC
| Mængde | 100mg |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
ApplicationsFexofenadine hydrochloride is used as an antihistamine that inhibits Cox-1, Cox-2, and is a histamine H1 receptor agonist.
Solubility
Soluble in Dimethyl sulfoxide (50 mM), and methanol.
Notes
Protect from heat. Store away from oxidizing agents.
Kemiske identifikatorer
| 153439-40-8 | |
| 538.13 | |
| RRJFVPUCXDGFJB-UHFFFAOYNA-N | |
| 63002 | |
| [H+].[Cl-].CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 |
| C32H40ClNO4 | |
| MFCD00865710 | |
| fexofenadine hydrochloride, fexofenadine hcl, allegra, telfast, 2-4-1-hydroxy-4-4-hydroxydiphenylmethyl piperidin-1-yl butyl phenyl-2-methylpropanoic acid hydrochloride, fexofenidine hydrochloride, terfenadine carboxylate hydrochloride, mdl 16455 hydrochloride, terfenidine carboxylate hydrochloride | |
| hydrogen 2-(4-{1-hydroxy-4-[4-(hydroxydiphenylmethyl)piperidin-1-yl]butyl}phenyl)-2-methylpropanoic acid chloride |
Tekniske data
| Fexofenadine hydrochloride | |
| C32H40ClNO4 | |
| 100mg | |
| fexofenadine hydrochloride, fexofenadine hcl, allegra, telfast, 2-4-1-hydroxy-4-4-hydroxydiphenylmethyl piperidin-1-yl butyl phenyl-2-methylpropanoic acid hydrochloride, fexofenidine hydrochloride, terfenadine carboxylate hydrochloride, mdl 16455 hydrochloride, terfenidine carboxylate hydrochloride | |
| RRJFVPUCXDGFJB-UHFFFAOYNA-N | |
| hydrogen 2-(4-{1-hydroxy-4-[4-(hydroxydiphenylmethyl)piperidin-1-yl]butyl}phenyl)-2-methylpropanoic acid chloride | |
| 63002 |
| 153439-40-8 | |
| MFCD00865710 | |
| 14,4068 | |
| Soluble in Dimethyl sulfoxide (50 mM),and methanol. | |
| [H+].[Cl-].CC(C)(C(O)=O)C1=CC=C(C=C1)C(O)CCCN1CCC(CC1)C(O)(C1=CC=CC=C1)C1=CC=CC=C1 | |
| 538.13 | |
| 538.12 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.