Learn More
Ethyl chrysanthemate, 95%, mixture of cis and trans, ACROS Organics™
Brand: Acros Organics 156065000
Additional Details : CAS Number : 97-41-6 Weight : 0.55000kg
| Packaging | Glass bottle |
|---|---|
| Quantity | 500g |
Chemical Identifiers
| 97-41-6 | |
| 196.29 | |
| VIMXTGUGWLAOFZ-UHFFFAOYSA-N | |
| 7334 | |
| CCOC(=O)C1C(C1(C)C)C=C(C)C |
| C12H20O2 | |
| MFCD00001304 | |
| ethyl chrysanthemate, ethyl chrysanthemumate, chrysanthemic acid ethyl ester, cyclopropanecarboxylic acid, 2,2-dimethyl-3-2-methyl-1-propenyl-, ethyl ester, ethylchrysanthemate, ccris 2498, chrysanthemic acid, ethyl ester, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methylprop-1-en-1-yl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropane-1-carboxylate | |
| ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
Specifications
| Ethyl chrysanthemate | |
| 84°C | |
| Glass bottle | |
| 0.9 | |
| 112°C (10.0mmHg) | |
| 500g | |
| 97-41-6 | |
| C12H20O2 | |
| 09, II, 45 | |
| VIMXTGUGWLAOFZ-UHFFFAOYSA-N | |
| ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | |
| 7334 | |
| Liquid |
| 0.9000g/mL | |
| Authentic | |
| 1.4590 to 1.461 | |
| 0.2% max. | |
| Colorless to Yellow | |
| 95% | |
| 94% min. (GC) | |
| MFCD00001304 | |
| ethyl chrysanthemate, ethyl chrysanthemumate, chrysanthemic acid ethyl ester, cyclopropanecarboxylic acid, 2,2-dimethyl-3-2-methyl-1-propenyl-, ethyl ester, ethylchrysanthemate, ccris 2498, chrysanthemic acid, ethyl ester, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methylprop-1-en-1-yl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropane-1-carboxylate | |
| CCOC(=O)C1C(C1(C)C)C=C(C)C | |
| 196.29 | |
| 196.29 | |
| 95% |