Learn More
Diphenylacetylene, 99%, ACROS Organics™
Brand: Acros Organics 117181000
Additional Details : CAS Number : 501-65-5 Weight : 0.15000kg
Packaging | Glass bottle |
---|---|
Quantity | 100g |
Chemical Identifiers
501-65-5 | |
178.23 | |
diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
CHEBI:51579 | |
C1=CC=C(C=C1)C#CC2=CC=CC=C2 |
C14H10 | |
JRXXLCKWQFKACW-UHFFFAOYSA-N | |
10390 | |
2-phenylethynylbenzene |
Specifications
Diphenylacetylene | |
Authentic | |
0.99 | |
Brown to Yellow | |
100g | |
98.5% min. (GC) | |
C6H5C≡CC6H5 | |
01,335 | |
diphenylacetylene, tolan, diphenylethyne, 1,2-diphenylethyne, tolane, 1,2-diphenylacetylene, benzene, 1,1'-1,2-ethynediyl bis, biphenylacetylene, diphenyl acetylene, ethyne, diphenyl | |
JRXXLCKWQFKACW-UHFFFAOYSA-N | |
2-phenylethynylbenzene | |
10390 | |
178.23 | |
99% |
0.9900g/mL | |
Glass bottle | |
170.0°C (19.0 mmHg) | |
58.0°C to 61.0°C | |
501-65-5 | |
C14H10 | |
05,656 | |
15,9664 | |
Solubility in water: insoluble. Other solubilities: soluble in ether and hot alcohol | |
C1=CC=C(C=C1)C#CC2=CC=CC=C2 | |
178.23 | |
CHEBI:51579 | |
Crystalline Powder and Chunks |