Få mere at vide
Cyclosporin A, 99+%, Thermo Scientific™
Cyclosporin A, CAS # 59865-13-3, is a compound that shows immunosuppressive, antifungal, antirheumatic, and dermatologic activities. It is also a calcineurin and enzyme inhibitor.
Brand: Thermo Scientific Alfa Aesar J63191.03
| Mængde | 1g |
|---|
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| 59865-13-3 | |
| 1202.64 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 132274082 | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C |
| C62H111N11O12 | |
| MFCD00274558 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone |
Tekniske data
| Cyclosporin A | |
| White | |
| C62H111N11O12 | |
| 3647785 | |
| Cyclosporine A; Antibiotic S 7481F1 | |
| PMATZTZNYRCHOR-IMVLJIQENA-N | |
| 30-ethyl-33-[(4E)-1-hydroxy-2-methylhex-4-en-1-yl]-1,4,7,10,12,15,19,25,28-nonamethyl-6,9,18,24-tetrakis(2-methylpropyl)-3,21-bis(propan-2-yl)-1,4,7,10,13,16,19,22,25,28,31-undecaazacyclotritriacontan-2,5,8,11,14,17,20,23,26,29,32-undecone | |
| 132274082 | |
| ≥99% |
| 59865-13-3 | |
| 1g | |
| MFCD00274558 | |
| 14,2752 | |
| Soluble in dimethyl sulfoxide and ethanol; Insoluble in water. | |
| CCC1NC(=O)C(C(O)C(C)C\C=C\C)N(C)C(=O)C(C(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(CC(C)C)N(C)C(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)N(C)C(=O)C(NC(=O)C(CC(C)C)N(C)C(=O)CN(C)C1=O)C(C)C | |
| 1202.64 | |
| 1202.61 |
Dit input er vigtigt for os. Udfyld denne formular for at give feedback relateret til indholdet på dette produkt.