Learn More
Alfa Aesar™ Coumarin-6-sulfonyl chloride, 97%
Brand: Alfa Aesar™ H54767.14
Additional Details : CAS Number : 10543-42-7 Weight : 0.02500kg Transport : UN number : 3261 Chem class : 8 Pack group : II
| Quantity | 25g |
|---|
Description
ApplicationsCoumarin-6-sulfonyl chloride is used as a derivatizing agent for amines and phenols.
Solubility
Slightly soluble in water.
Notes
Moisture sensitive. Incompatible with oxidizing agents and bases.
Chemical Identifiers
| 10543-42-7 | |
| 244.645 | |
| HQIPMBGUDSOVEA-UHFFFAOYSA-N | |
| 2735833 | |
| C1=CC2=C(C=CC(=O)O2)C=C1S(=O)(=O)Cl |
| C9H5ClO4S | |
| MFCD01941320 | |
| 2-oxo-2h-chromene-6-sulfonyl chloride, coumarin-6-sulfonyl chloride, 6-cs-cl, coumarin-6-sulphonyl chloride, 2-oxo-2h-chromene-6-sulphonyl chloride, 2-oxo-2h-1-benzopyran-6-sulfonyl chloride, 6-chlorosulfonyl chromen-2-one, pubchem5506, c6scl, timtec-bb sbb002796 | |
| 2-oxochromene-6-sulfonyl chloride |
Specifications
| Coumarin-6-sulfonyl chloride | |
| 25g | |
| C9H5ClO4S | |
| UN3261 | |
| 2-oxo-2h-chromene-6-sulfonyl chloride, coumarin-6-sulfonyl chloride, 6-cs-cl, coumarin-6-sulphonyl chloride, 2-oxo-2h-chromene-6-sulphonyl chloride, 2-oxo-2h-1-benzopyran-6-sulfonyl chloride, 6-chlorosulfonyl chromen-2-one, pubchem5506, c6scl, timtec-bb sbb002796 | |
| HQIPMBGUDSOVEA-UHFFFAOYSA-N | |
| 2-oxochromene-6-sulfonyl chloride | |
| 2735833 | |
| 97% |
| Moisture sensitive | |
| 10543-42-7 | |
| MFCD01941320 | |
| 196167 | |
| Slightly soluble in water. | |
| C1=CC2=C(C=CC(=O)O2)C=C1S(=O)(=O)Cl | |
| 244.645 | |
| 244.65 |