Få mere at vide
Clozapine, 97%, Thermo Scientific™
Potent, selective muscarinic antagonist
Brand: Thermo Scientific Alfa Aesar J61583.MB
| Mængde | 25mg |
|---|
Se flere versioner af dette produkt
Beskrivelse
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Kemiske identifikatorer
| C18H19ClN4 | |
| MFCD00153785 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine |
Tekniske data
| Clozapine | |
| C18H19ClN4 | |
| 25mg | |
| 14,2423 | |
| ZUXABONWMNSFBN-UHFFFAOYSA-N | |
| 3-chloro-6-(4-methylpiperazin-1-yl)-5H-benzo[b][1,4]benzodiazepine | |
| 2818 | |
| ≥98% |
| 5786-21-0 | |
| MFCD00153785 | |
| UN2811 | |
| clozapine, leponex, clozapin, clozaril, fazaclo, clorazil, iprox, clozapinum, asaleptin, clozapina | |
| CN1CCN(CC1)C2=C3C=CC=CC3=NC4=C(N2)C=C(C=C4)Cl | |
| 326.828 | |
| 326.83 |
Ved at klikke på Send, anerkender du, at du kan blive kontaktet af Fisher Scientific med hensyn til den feedback, du har givet i denne formular. Vi deler ikke dine oplysninger til andre formål. Alle angivne kontaktoplysninger skal også vedligeholdes i overensstemmelse med vores Privatlivspolitik.